
CAS Number21894-06-4
Synonyms1-hydroxy-4-(4-nitrophenoxy)naphthalene-2-carboxylic acid; 1-hydroxy-4-(4-nitrophenoxy)-2-naphthalenecarboxylic acid; 1-Hydroxy-4-(4-nitrophenoxy)-2-naphthoic acid; ST5447445; 2-Naphthalenecarboxylic acid, 1-hydroxy-4-(4-nitrophenoxy)-
Molecular FormulaC17H11NO6
Molecular Weight325.28
Purity98.00%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21894-06-4 |
| Catalog No. | 2A-9038802 |
| Chinese Name | 1-羟基-4-(4-硝基苯氧基)-2-萘甲酸 |
| Synonyms | 1-hydroxy-4-(4-nitrophenoxy)naphthalene-2-carboxylic acid; 1-hydroxy-4-(4-nitrophenoxy)-2-naphthalenecarboxylic acid; 1-Hydroxy-4-(4-nitrophenoxy)-2-naphthoic acid; ST5447445; 2-Naphthalenecarboxylic acid, 1-hydroxy-4-(4-nitrophenoxy)- |
| Molecular Formula | C17H11NO6 |
| Molecular Weight | 325.28 |
| Purity | 98.00 |
| HTC | 2918990090 |
| MDL Number | MFCD00185927 |
| SMILES | O=C(O)c1cc(Oc2ccc([N+](=O)[O-])cc2)c2ccccc2c1O |
| InChI | InChI=1S/C17H11NO6/c19-16-13-4-2-1-3-12(13)15(9-14(16)17(20)21)24-11-7-5-10(6-8-11)18(22)23/h1-9,19H,(H,20,21) |
| InChI Key | DBNQZGPCPCXGCX-UHFFFAOYSA-N |
| MSDS | msds/38802_1_21894_06_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Prop-1-ene-1,3-sultone | 21806-61-1 | 2A-9038784 |
| Cocal | 21834-92-4 | 2A-9038787 |
| 3-Ethyl-2-hydroxy-2-cyclopenten-1-one | 21835-01-8 | 2A-9038788 |
| 2,3'-Dichloroacetophenone | 21886-56-6 | 2A-9038798 |
| 3-Methyl-2-benzoxazolinone | 21892-80-8 | 2A-9038800 |
| Clenbuterol hydrochloride | 21898-19-1 | 2A-9038803 |
| 5-Fluoro-2-methylbenzoyl chloride | 21900-39-0 | 2A-9038805 |
| 2-Chloro-5-fluorobenzoyl chloride | 21900-51-6 | 2A-9038807 |
| Mercury monoxide | 21908-53-2 | 2A-9038818 |
| Methyl 3-(phenylamino)propanoate | 21911-84-2 | 2A-9038819 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA