
CAS Number21886-56-6
SynonymsMFCD07783975; m-chlorophenacyl chloride; 3-chlorophenyl chloromethyl ketone; 2-Chloro-1-(3-chlorophenyl)ethanone; 3-chlorophenacyl chloride; chloromethyl m-chlorophenyl ketone
Molecular FormulaC8H6Cl2O
Molecular Weight189.039
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point283.7±20.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21886-56-6 |
| Catalog No. | 2A-9038798 |
| Chinese Name | 2,3'-二氯苯乙酮 |
| Synonyms | MFCD07783975; m-chlorophenacyl chloride; 3-chlorophenyl chloromethyl ketone; 2-Chloro-1-(3-chlorophenyl)ethanone; 3-chlorophenacyl chloride; chloromethyl m-chlorophenyl ketone |
| Molecular Formula | C8H6Cl2O |
| Molecular Weight | 189.039 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 283.7±20.0 °C at 760 mmHg |
| Storage Condition | room temperature, sealed |
| HTC | 2914700090 |
| SMILES | O=C(CCl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2O/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4H,5H2 |
| InChI Key | AVUVSYIYUADCKE-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| D-Ethylgonendione | 21800-83-9 | 2A-9038781 |
| 4-Amino-3-chlorobenzonitrile | 21803-75-8 | 2A-9038783 |
| Prop-1-ene-1,3-sultone | 21806-61-1 | 2A-9038784 |
| Cocal | 21834-92-4 | 2A-9038787 |
| 3-Ethyl-2-hydroxy-2-cyclopenten-1-one | 21835-01-8 | 2A-9038788 |
| 3-Methyl-2-benzoxazolinone | 21892-80-8 | 2A-9038800 |
| 1-Hydroxy-4-(4-nitrophenoxy)-2-naphthoic acid | 21894-06-4 | 2A-9038802 |
| Clenbuterol hydrochloride | 21898-19-1 | 2A-9038803 |
| 5-Fluoro-2-methylbenzoyl chloride | 21900-39-0 | 2A-9038805 |
| 2-Chloro-5-fluorobenzoyl chloride | 21900-51-6 | 2A-9038807 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA