
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 49850-16-0 |
| Catalog No. | 2A-9003839 |
| Chinese Name | 3,5-双(三氟甲基)-N-乙基苯胺 |
| Synonyms | 3,5-Bis(trifluoromethyl)-N-ethylaniline; MFCD00203993 |
| Molecular Formula | C15H10F6N2O |
| Molecular Weight | 348.25 |
| Purity | 97 |
| Density | 1.336 g/cm3 |
| Boiling Point | 96-98°C 15mm |
| Storage Condition | Keep the container sealed, store in a cool, dry pl |
| HTC | 2921420090 |
| MDL Number | MFCD03042421 |
| SMILES | CCNc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI Key | WOIXGFNIYODSEA-UHFFFAOYSA-N |
| MSDS | msds/3839_1_49850_16_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-Bis(trifluoromethyl)benzyl alcohol | 32707-89-4 | 2A-9003834 |
| 3,5-Bis(trifluoromethyl)benzyl bromide | 32247-96-4 | 2A-9003835 |
| 3,5-Bis(trifluoromethyl)benzyl chloride | 75462-59-8 | 2A-9003836 |
| 3,5-Bis(trifluoromethyl)chlorobenzene | 328-72-3 | 2A-9003837 |
| 3,5-Bis(trifluoromethyl)iodobenzene | 328-73-4 | 2A-9003838 |
| 3,5-Bis(trifluoromethyl)phenyl hydrazine hydrochloride | 502496-23-3 | 2A-9003841 |
| 3,5-Bis(trifluoromethyl)phenylacetic acid | 85068-33-3 | 2A-9003844 |
| 3,5-Bis(trifluoromethyl)phenylacetonitrile | 85068-32-2 | 2A-9003845 |
| 3,5-Bis(trifluoromethyl)phenylacetylchloride | 174083-39-7 | 2A-9003846 |
| 3,5-Bis(trifluoromethyl)phenylhydrazine | 886-35-1 | 2A-9003847 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA