
CAS Number502496-23-3
Synonyms[3,5-Bis(trifluoromethyl)phenyl]hydrazine hydrochloride; [3,5-Bis(trifluoromethyl)phenyl]hydrazinium chloride; FXFFR CMZ EXFFF &&HCl; 3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride; [3,5-bis(trifluoromethyl)phenyl]hydrazine,hydrochloride; MFCD03094165; [3,5-Bis(trifluoromethyl)phenyl]hydrazine hydrochloride (1:1); Hydrazine, [3,5-bis(trifluoromethyl)phenyl]-, hydrochloride (1:1)
Molecular FormulaC8H7ClF6N2
Molecular Weight280.598
Purity98%
Boiling Point237.7ºC at 760 mmHg
Melting Point80-83ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 502496-23-3 |
| Catalog No. | 2A-9003841 |
| Chinese Name | 3,5-双(三氟甲基)苯肼盐酸盐 |
| Synonyms | [3,5-Bis(trifluoromethyl)phenyl]hydrazine hydrochloride; [3,5-Bis(trifluoromethyl)phenyl]hydrazinium chloride; FXFFR CMZ EXFFF &&HCl; 3,5-Bis(trifluoromethyl)phenylhydrazine hydrochloride; [3,5-bis(trifluoromethyl)phenyl]hydrazine,hydrochloride; MFCD03094165; [3,5-Bis(trifluoromethyl)phenyl]hydrazine hydrochloride (1:1); Hydrazine, [3,5-bis(trifluoromethyl)phenyl]-, hydrochloride (1:1) |
| Molecular Formula | C8H7ClF6N2 |
| Molecular Weight | 280.598 |
| Purity | 98 |
| Boiling Point | 237.7ºC at 760 mmHg |
| Melting Point | 80-83ºC |
| Storage Condition | Room Temperature |
| HTC | 2928000090 |
| SMILES | Cl.NNc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI Key | OPIOKSFIERNABH-UHFFFAOYSA-N |
| MSDS | msds/3841_1_502496_23_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-Bis(trifluoromethyl)benzyl bromide | 32247-96-4 | 2A-9003835 |
| 3,5-Bis(trifluoromethyl)benzyl chloride | 75462-59-8 | 2A-9003836 |
| 3,5-Bis(trifluoromethyl)chlorobenzene | 328-72-3 | 2A-9003837 |
| 3,5-Bis(trifluoromethyl)iodobenzene | 328-73-4 | 2A-9003838 |
| 3,5-Bis(trifluoromethyl)-N-ethylaniline | 49850-16-0 | 2A-9003839 |
| 3,5-Bis(trifluoromethyl)phenylacetic acid | 85068-33-3 | 2A-9003844 |
| 3,5-Bis(trifluoromethyl)phenylacetonitrile | 85068-32-2 | 2A-9003845 |
| 3,5-Bis(trifluoromethyl)phenylacetylchloride | 174083-39-7 | 2A-9003846 |
| 3,5-Bis(trifluoromethyl)phenylhydrazine | 886-35-1 | 2A-9003847 |
| 3,5-Bis(trifluoromethyl)thiophenol | 130783-02-7 | 2A-9003849 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA