
CAS Number32707-89-4
SynonymsEINECS 251-168-9; [3,5-Bis(trifluoromethyl)phenyl]methanol; [3,5-Di(trifluoromethyl)phenyl]methanol; 3,5-Bis(trifluoromethyl)benzenemethanol; 3,5-Bis(Trifluoromethyl)benzyl alcohol; [3,5-Bis(trifluoromethyl)phenyl]methan-1-ol; 3,5-Di(trifluoromethyl)benzyl alcohol; FXFFR C1Q EXFFF; MFCD00009907; (3,5-Bis(trifluoromethyl)phenyl)methanol
Molecular Formula(CF3)2C6H3CH2Br
Molecular Weight307.03
Purity97%
Density1.4±0.1 g/cm3
Boiling Point173.9±35.0 °C at 760 mmHg
Melting Point53-56 °C(lit.)
Appearanceliquid
EINECS250-971-1
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32707-89-4 |
| Catalog No. | 2A-9003834 |
| Chinese Name | 3,5-二(三氟甲基)苯甲醇 |
| Synonyms | EINECS 251-168-9; [3,5-Bis(trifluoromethyl)phenyl]methanol; [3,5-Di(trifluoromethyl)phenyl]methanol; 3,5-Bis(trifluoromethyl)benzenemethanol; 3,5-Bis(Trifluoromethyl)benzyl alcohol; [3,5-Bis(trifluoromethyl)phenyl]methan-1-ol; 3,5-Di(trifluoromethyl)benzyl alcohol; FXFFR C1Q EXFFF; MFCD00009907; (3,5-Bis(trifluoromethyl)phenyl)methanol |
| Molecular Formula | (CF3)2C6H3CH2Br |
| Molecular Weight | 307.03 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 173.9±35.0 °C at 760 mmHg |
| Melting Point | 53-56 °C(lit.) |
| Appearance | liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| EINECS | 250-971-1 |
| HTC | 2906299090 |
| PubChem ID | 24855968 |
| MDL Number | MFCD00009905 |
| SMILES | FC(F)(F)c1cc(CBr)cc(c1)C(F)(F)F |
| InChI | 1S/C9H5BrF6/c10-4-5-1-6(8(11,12)13)3-7(2-5)9(14,15)16/h1-3H,4H2 |
| InChI Key | ATLQGZVLWOURFU-UHFFFAOYSA-N |
| Beilstein/REAXYS | 656506 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/3834_1_32707_89_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3,5-Bis(trifluoromethyl)benzyl alcohol Modification number: 5 |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-Bis(trifluoromethyl)benzenesulphonylguanidine | 175136-69-3 | 2A-9003829 |
| 3,5-Bis(trifluoromethyl)benzoic acid | 725-89-3 | 2A-9003830 |
| 3,5-Bis(trifluoromethyl)benzoic acid hydrazide | 26107-82-4 | 2A-9003831 |
| 3,5-Bis(trifluoromethyl)benzonitrile | 27126-93-8 | 2A-9003832 |
| 3,5-Bis(trifluoromethyl)benzophenone | 21221-93-2 | 2A-9003833 |
| 3,5-Bis(trifluoromethyl)benzyl bromide | 32247-96-4 | 2A-9003835 |
| 3,5-Bis(trifluoromethyl)benzyl chloride | 75462-59-8 | 2A-9003836 |
| 3,5-Bis(trifluoromethyl)chlorobenzene | 328-72-3 | 2A-9003837 |
| 3,5-Bis(trifluoromethyl)iodobenzene | 328-73-4 | 2A-9003838 |
| 3,5-Bis(trifluoromethyl)-N-ethylaniline | 49850-16-0 | 2A-9003839 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA