
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26107-82-4 |
| Catalog No. | 2A-9003831 |
| Chinese Name | 3,5-二(三氟甲基)苯-1-碳酰肼 |
| Synonyms | MFCD00051848; EINECS 247-462-1; 3,5-Bis(trifluoromethyl)benzhydrazide |
| Molecular Formula | C9H6F6N2O |
| Molecular Weight | 272.14700 |
| Purity | 97 |
| Density | 1.479 g/cm3 |
| Melting Point | 131-135 °C |
| Appearance | White crystalline powder |
| Storage Condition | Keep receptacle sealed Store in a compact containe |
| HTC | 2928000090 |
| SMILES | NNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F6N2O/c10-8(11,12)5-1-4(7(18)17-16)2-6(3-5)9(13,14)15/h1-3H,16H2,(H,17,18) |
| InChI Key | GBBRFBSFWKFTMZ-UHFFFAOYSA-N |
| MSDS | msds/3831_1_26107_82_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3,5-Bis(trifluoromethyl)benzaldehyde | 401-95-6 | 2A-9003826 |
| 3,5-Bis(trifluoromethyl)benzamidoxime | 72111-09-2 | 2A-9003827 |
| 3,5-Bis(trifluoromethyl)benzenesulphonyl chloride | 39234-86-1 | 2A-9003828 |
| 3,5-Bis(trifluoromethyl)benzenesulphonylguanidine | 175136-69-3 | 2A-9003829 |
| 3,5-Bis(trifluoromethyl)benzoic acid | 725-89-3 | 2A-9003830 |
| 3,5-Bis(trifluoromethyl)benzonitrile | 27126-93-8 | 2A-9003832 |
| 3,5-Bis(trifluoromethyl)benzophenone | 21221-93-2 | 2A-9003833 |
| 3,5-Bis(trifluoromethyl)benzyl alcohol | 32707-89-4 | 2A-9003834 |
| 3,5-Bis(trifluoromethyl)benzyl bromide | 32247-96-4 | 2A-9003835 |
| 3,5-Bis(trifluoromethyl)benzyl chloride | 75462-59-8 | 2A-9003836 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA