CAS Number20319-44-2
Synonyms1,3-Benzenedicarboxylic acid, 5-methoxy-, dimethyl ester; 5-methoxyisophthalic acid dimethyl ester; MFCD00272337; Dimethyl 5-methoxyisophthalate; 5-Methoxy-dimethyl isophathalate; 5-methoxy-1,3-benzenedicarboxylic acid dimethyl ester; 5-Methoxy-isophthalsaeure-dimethylester; methyl 3-methoxy-5-(methoxycarbonyl)benzoate; bis-methyl 5-methoxyisophthalate
Molecular FormulaC11H12O5
Molecular Weight224.210
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point323.4±22.0 °C at 760 mmHg
Melting Point108-112ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20319-44-2 |
| Catalog No. | 2A-9038373 |
| Chinese Name | 5-甲氧基-异邻苯二甲酸二甲酯 |
| Synonyms | 1,3-Benzenedicarboxylic acid, 5-methoxy-, dimethyl ester; 5-methoxyisophthalic acid dimethyl ester; MFCD00272337; Dimethyl 5-methoxyisophthalate; 5-Methoxy-dimethyl isophathalate; 5-methoxy-1,3-benzenedicarboxylic acid dimethyl ester; 5-Methoxy-isophthalsaeure-dimethylester; methyl 3-methoxy-5-(methoxycarbonyl)benzoate; bis-methyl 5-methoxyisophthalate |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.210 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 323.4±22.0 °C at 760 mmHg |
| Melting Point | 108-112ºC(lit.) |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| SMILES | COC(=O)c1cc(OC)cc(C(=O)OC)c1 |
| InChI Key | XZWYGKPSIBDYDY-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Pentyl 4-oxovalerate | 20279-49-6 | 2A-9038358 |
| 6-Chloro-5-ethyluracil | 20295-24-3 | 2A-9038363 |
| 9,9-Diphenylfluorene | 20302-14-1 | 2A-9038367 |
| 5-Methylbenzofurazan | 20304-86-3 | 2A-9038368 |
| N-Methylacetoacetamide | 20306-75-6 | 2A-9038369 |
| Ethyl 2-amino-4,5-dimethoxybenzoate | 20323-74-4 | 2A-9038374 |
| Disodium 7,7'-(carbonyldiimino)bis(4-hydroxynaphthalene-2-sulphonate) | 20324-87-2 | 2A-9038376 |
| 3,4,5-Trimethoxycinnamic acid | 20329-98-0 | 2A-9038379 |
| Ethyl methyl disulphide | 20333-39-5 | 2A-9038380 |
| Iron hydroxide oxide | 20344-49-4 | 2A-9038381 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS