
CAS Number20306-75-6
SynonymsMFCD00044026; MMAA; N-Methyl-3-oxobutanamide; AAMA; EINECS 243-723-9; N-methyl-2,4-dioxobutanamide; N-Methylacetylacetamide; Acetoacetylmethylamine; acetoacetic acid monomethylamide; N-methyl-3-oxobutaneamide; N-MONOMETHYLACETOACETAMIDE; N-Methylacetoacetamide; Acetoacet-monomethylamide; n-methyl-3-oxobutyramide; monomethylacetoacetamide; N-Acetoacetylmethylamine; 1V1VM1; AcetoN-methylacetamide; N-Methylacetoacetamid
Molecular FormulaC5H9O2N1
Molecular Weight115.13
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point279.4±23.0 °C at 760 mmHg
Melting Point-3 °C
AppearanceColorless to light yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20306-75-6 |
| Catalog No. | 2A-9038369 |
| Chinese Name | N-甲基乙酰基乙酰胺 |
| Synonyms | MFCD00044026; MMAA; N-Methyl-3-oxobutanamide; AAMA; EINECS 243-723-9; N-methyl-2,4-dioxobutanamide; N-Methylacetylacetamide; Acetoacetylmethylamine; acetoacetic acid monomethylamide; N-methyl-3-oxobutaneamide; N-MONOMETHYLACETOACETAMIDE; N-Methylacetoacetamide; Acetoacet-monomethylamide; n-methyl-3-oxobutyramide; monomethylacetoacetamide; N-Acetoacetylmethylamine; 1V1VM1; AcetoN-methylacetamide; N-Methylacetoacetamid |
| Molecular Formula | C5H9O2N1 |
| Molecular Weight | 115.13 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 279.4±23.0 °C at 760 mmHg |
| Melting Point | -3 °C |
| Appearance | Colorless to light yellow transparent liquid |
| Water Solubility | hydrolysis |
| Storage Condition | Place in a tight container and store in a cool, dr |
| HTC | 2924199090 |
| MDL Number | MFCD18834730 |
| SMILES | CNC(=O)CC(C)=O |
| InChI | InChI=1S/C5H9NO2/c1-4(7)3-5(8)6-2/h3H2,1-2H3,(H,6,8) |
| InChI Key | ATWLCPHWYPSRBQ-UHFFFAOYSA-N |
| MSDS | msds/38369_1_20306_75_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 70.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Butyl pyruvate | 20279-44-1 | 2A-9038357 |
| Pentyl 4-oxovalerate | 20279-49-6 | 2A-9038358 |
| 6-Chloro-5-ethyluracil | 20295-24-3 | 2A-9038363 |
| 9,9-Diphenylfluorene | 20302-14-1 | 2A-9038367 |
| 5-Methylbenzofurazan | 20304-86-3 | 2A-9038368 |
| Dimethyl 5-methoxyisophthalate | 20319-44-2 | 2A-9038373 |
| Ethyl 2-amino-4,5-dimethoxybenzoate | 20323-74-4 | 2A-9038374 |
| Disodium 7,7'-(carbonyldiimino)bis(4-hydroxynaphthalene-2-sulphonate) | 20324-87-2 | 2A-9038376 |
| 3,4,5-Trimethoxycinnamic acid | 20329-98-0 | 2A-9038379 |
| Ethyl methyl disulphide | 20333-39-5 | 2A-9038380 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA