
CAS Number17556-19-3
Synonyms7-Chloro-3,4-dihydro-2(1H)-naphthalenone; 7-chloro-1,2,3,4-tetrahydronaphthalene-2-one; 7-Chloro-2-tetralone; 7-chloro-3,4-dihydronaphthalen-2(1H)-one
Molecular FormulaC10H9ClO
Molecular Weight180.63
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point304.6±42.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17556-19-3 |
| Catalog No. | 2A-9037527 |
| Chinese Name | 5-氯-3,4-二氢-1H-2-萘酮 |
| Synonyms | 7-Chloro-3,4-dihydro-2(1H)-naphthalenone; 7-chloro-1,2,3,4-tetrahydronaphthalene-2-one; 7-Chloro-2-tetralone; 7-chloro-3,4-dihydronaphthalen-2(1H)-one |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 304.6±42.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2914700090 |
| PubChem ID | 5975643 |
| SMILES | O=C1CCc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C10H9ClO/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1,3,5H,2,4,6H2 |
| InChI Key | CSIHHNSBJNDXNO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Molybdenyl acetylacetonate | 17524-05-9 | 2A-9037521 |
| 1H,1H,2H,2H-Perfluorooctyl acrylate | 17527-29-6 | 2A-9037522 |
| Bis(4-mercaptophenyl) ether | 17527-79-6 | 2A-9037523 |
| 4-sec-Butyl-2,6-di-tert-butylphenol | 17540-75-9 | 2A-9037525 |
| 6-Chloro-2-tetralone | 17556-18-2 | 2A-9037526 |
| 5,7-Dichloro-2-tetralone | 17556-20-6 | 2A-9037528 |
| 6,7-Dichloro-2-tetralone | 17556-22-8 | 2A-9037529 |
| 3-Azetidinone hydrochloride | 17557-84-5 | 2A-9037532 |
| Lead(II) methanesulfonate | 17570-76-2 | 2A-9037535 |
| 2-Amino-5,6-dihydro-4H-benzothiazol-7-one | 17583-10-7 | 2A-9037539 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA