CAS Number17527-29-6
SynonymsEINECS 241-527-8; 1H,1H,2H,2H-Perfluorooctyl acrylate; MFCD00042351; Acrylic Acid 1H,1H,2H,2H-Tridecafluoro-n-octyl Ester; 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl acrylate; 1H,1H,2H,2H-perfluorooctyl acrylate TFOA; 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate; 2-Propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester; 1H,1H,2H,2H-Tridecafluoro-n-octyl Acrylate; 1H, 1H, 2H, 2H-Perfluorooctyl acrylate
Molecular FormulaH2C=CHCO2CH2CH2(CF2)5CF3
Molecular Weight418.15
Purity97%
Density1.5±0.1 g/cm3
Boiling Point76-80 °C/8 mmHg (lit.)
AppearanceLiquid;Colorless to Light yellow clear liquid
EINECS241-527-8
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17527-29-6 |
| Catalog No. | 2A-9037522 |
| Chinese Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-十三氟辛基丙烯酸酯 |
| Synonyms | EINECS 241-527-8; 1H,1H,2H,2H-Perfluorooctyl acrylate; MFCD00042351; Acrylic Acid 1H,1H,2H,2H-Tridecafluoro-n-octyl Ester; 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl acrylate; 1H,1H,2H,2H-perfluorooctyl acrylate TFOA; 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate; 2-Propenoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester; 1H,1H,2H,2H-Tridecafluoro-n-octyl Acrylate; 1H, 1H, 2H, 2H-Perfluorooctyl acrylate |
| Molecular Formula | H2C=CHCO2CH2CH2(CF2)5CF3 |
| Molecular Weight | 418.15 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 76-80 °C/8 mmHg (lit.) |
| Appearance | Liquid;Colorless to Light yellow clear liquid |
| Storage Condition | 2-8°C |
| EINECS | 241-527-8 |
| HTC | 2916129000 |
| PubChem ID | 24870991 |
| MDL Number | MFCD00042351 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC(=O)C=C |
| InChI | 1S/C11H7F13O2/c1-2-5(25)26-4-3-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h2H,1,3-4H2 |
| InChI Key | VPKQPPJQTZJZDB-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12162002 |
| MSDS | msds/37522_1_17527_29_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Lithium tri-tert-butoxyaluminum hydride | 17476-04-9 | 2A-9037504 |
| 4-Methyl-3-nitroanisole | 17484-36-5 | 2A-9037509 |
| 2-Methyl-1-indanone | 17496-14-9 | 2A-9037510 |
| 1-[(2-Chlorophenyl)thio]-2-propanone | 17514-52-2 | 2A-9037515 |
| Molybdenyl acetylacetonate | 17524-05-9 | 2A-9037521 |
| Bis(4-mercaptophenyl) ether | 17527-79-6 | 2A-9037523 |
| 4-sec-Butyl-2,6-di-tert-butylphenol | 17540-75-9 | 2A-9037525 |
| 6-Chloro-2-tetralone | 17556-18-2 | 2A-9037526 |
| 5-Chloro-2-tetralone | 17556-19-3 | 2A-9037527 |
| 5,7-Dichloro-2-tetralone | 17556-20-6 | 2A-9037528 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS