
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17556-22-8 |
| Catalog No. | 2A-9037529 |
| Chinese Name | 6,7-二氯-3,4-二氢萘-2(1H)-酮 |
| Synonyms | 6,7-dichloro-3,4-dihydro-2(1H)-naphthalenone; 6.7-dichlorotetralone; 6,7-dichloro-2-tetralone; 6,7-Dichlor-tetralon-(2) |
| Molecular Formula | C10H8O1Cl2 |
| Molecular Weight | 215.08 |
| Purity | 98.00 |
| Density | 1.372g/cm3 |
| Boiling Point | 337.7ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| PubChem ID | 6564474 |
| MDL Number | MFCD06858485 |
| SMILES | O=C1CCc2cc(Cl)c(Cl)cc2C1 |
| InChI | InChI=1S/C10H8Cl2O/c11-9-4-6-1-2-8(13)3-7(6)5-10(9)12/h4-5H,1-3H2 |
| InChI Key | BEZIJCXXAGNMFX-UHFFFAOYSA-N |
| MSDS | msds/37529_1_17556_22_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Bis(4-mercaptophenyl) ether | 17527-79-6 | 2A-9037523 |
| 4-sec-Butyl-2,6-di-tert-butylphenol | 17540-75-9 | 2A-9037525 |
| 6-Chloro-2-tetralone | 17556-18-2 | 2A-9037526 |
| 5-Chloro-2-tetralone | 17556-19-3 | 2A-9037527 |
| 5,7-Dichloro-2-tetralone | 17556-20-6 | 2A-9037528 |
| 3-Azetidinone hydrochloride | 17557-84-5 | 2A-9037532 |
| Lead(II) methanesulfonate | 17570-76-2 | 2A-9037535 |
| 2-Amino-5,6-dihydro-4H-benzothiazol-7-one | 17583-10-7 | 2A-9037539 |
| 5,6-Dimethyl-1,2,4-triazin-3-amine | 17584-12-2 | 2A-9037540 |
| L-Aspartic acid hydrochloride | 17585-59-0 | 2A-9037541 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA