
CAS Number14963-97-4
Synonyms3-methoxybenzene-1,2-dicarboxylicacid; 3-Methoxyphthalic acid; 3-Methoxyphthalsaeure; 3-Methoxy-phthalic acid
Molecular FormulaC9H8O5
Molecular Weight196.16
Purity97.00%
Density1.4±0.1 g/cm3
Boiling Point395.7±27.0 °C at 760 mmHg
Melting Point173-174 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14963-97-4 |
| Catalog No. | 2A-9036403 |
| Chinese Name | 3-甲氧基苯-1,2-二甲酸 |
| Synonyms | 3-methoxybenzene-1,2-dicarboxylicacid; 3-Methoxyphthalic acid; 3-Methoxyphthalsaeure; 3-Methoxy-phthalic acid |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 |
| Purity | 97.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 395.7±27.0 °C at 760 mmHg |
| Melting Point | 173-174 °C |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918990090 |
| PubChem ID | 134259 |
| SMILES | COc1cccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C9H8O5/c1-14-6-4-2-3-5(8(10)11)7(6)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChI Key | DULQZGQVLHMCAU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-4-hydroxy-1H-quinolin-2-one | 14933-25-6 | 2A-9036395 |
| Cetyltributylphosphonium bromide | 14937-45-2 | 2A-9036397 |
| 4-Nitrophenyl-N-acetyl-beta-D-galactosaminide | 14948-96-0 | 2A-9036400 |
| N-(6-Chloro-3-pyridazinyl)acetamide | 14959-31-0 | 2A-9036401 |
| 2,4'-Diaminobenzophenone | 14963-42-9 | 2A-9036402 |
| L-Argininamide dihydrochloride | 14975-30-5 | 2A-9036406 |
| Clemastine fumarate | 14976-57-9 | 2A-9036407 |
| Ethyl 2-bromotetradecanoate | 14980-92-8 | 2A-9036408 |
| 4,4'-Diphenoxybenzophenone | 14984-21-5 | 2A-9036409 |
| D-Glucuronic acid sodium salt | 14984-34-0 | 2A-9036410 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA