
CAS Number14963-42-9
Synonyms2.4'-Diamino-benzophenon; (2-aminophenyl)(4-aminophenyl)methanon; 2,4'-diamino-benzophenone; 2,4'-Diaminobenzophenone; (2-Aminophenyl)(4-aminophenyl)methanone; 2,3-DIFLUOROBENZAMIDINE HYDROCHLORIDE
Molecular FormulaC13H12N2O
Molecular Weight212.247
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point464.7±30.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14963-42-9 |
| Catalog No. | 2A-9036402 |
| Chinese Name | 2,4'-二氨基二苯甲酮 |
| Synonyms | 2.4'-Diamino-benzophenon; (2-aminophenyl)(4-aminophenyl)methanon; 2,4'-diamino-benzophenone; 2,4'-Diaminobenzophenone; (2-Aminophenyl)(4-aminophenyl)methanone; 2,3-DIFLUOROBENZAMIDINE HYDROCHLORIDE |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.247 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 464.7±30.0 °C at 760 mmHg |
| HTC | 2922399090 |
| PubChem ID | 10256376 |
| SMILES | Nc1ccc(C(=O)c2ccccc2N)cc1 |
| InChI | InChI=1S/C13H12N2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H,14-15H2 |
| InChI Key | JEXYPPOFQZMCCI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(N,N-Dimethylmyristylammonio)propanesulfonate | 14933-09-6 | 2A-9036394 |
| 3-Chloro-4-hydroxy-1H-quinolin-2-one | 14933-25-6 | 2A-9036395 |
| Cetyltributylphosphonium bromide | 14937-45-2 | 2A-9036397 |
| 4-Nitrophenyl-N-acetyl-beta-D-galactosaminide | 14948-96-0 | 2A-9036400 |
| N-(6-Chloro-3-pyridazinyl)acetamide | 14959-31-0 | 2A-9036401 |
| 3-Methoxyphthalic acid | 14963-97-4 | 2A-9036403 |
| L-Argininamide dihydrochloride | 14975-30-5 | 2A-9036406 |
| Clemastine fumarate | 14976-57-9 | 2A-9036407 |
| Ethyl 2-bromotetradecanoate | 14980-92-8 | 2A-9036408 |
| 4,4'-Diphenoxybenzophenone | 14984-21-5 | 2A-9036409 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA