
CAS Number14984-34-0
SynonymsEINECS 239-065-7; MFCD00135616; D(+)-Glucuronic acid; D-GLUCURONIC ACID SODIUM SALT
Molecular FormulaC6H9NaO7
Molecular Weight234.14
Purity97.5-102.5 (non-aqueous titration)%
Boiling Point553.4ºC at 760mmHg
Melting Point138 °C (dec.) (lit.)
Appearancepowder
EINECS239-065-7
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14984-34-0 |
| Catalog No. | 2A-9036410 |
| Chinese Name | D-葡糖醛酸钠 |
| Synonyms | EINECS 239-065-7; MFCD00135616; D(+)-Glucuronic acid; D-GLUCURONIC ACID SODIUM SALT |
| Molecular Formula | C6H9NaO7 |
| Molecular Weight | 234.14 |
| Purity | 97.5-102.5 (non-aqueous titration) |
| Boiling Point | 553.4ºC at 760mmHg |
| Melting Point | 138 °C (dec.) (lit.) |
| Appearance | powder |
| Storage Condition | Sealed at room temperature, protected from light, |
| EINECS | 239-065-7 |
| HTC | 2918990090 |
| PubChem ID | 329799980 |
| MDL Number | MFCD12966022 |
| SMILES | O.[Na+].OC1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C([O-])=O |
| InChI | 1S/C6H10O7.Na.H2O/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;;/h1-4,6-9,12H,(H,10,11);;1H2/q;+1;/p-1/t1-,2-,3+,4-,6?;;/m0../s1 |
| InChI Key | FDXOVWIMYQPHRO-HWZSTGBWSA-M |
| Beilstein/REAXYS | 4218577 |
| NACRES Code | NA.25 |
| UNSPSC | 12352201 |
| MSDS | msds/36410_1_14984_34_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Methoxyphthalic acid | 14963-97-4 | 2A-9036403 |
| L-Argininamide dihydrochloride | 14975-30-5 | 2A-9036406 |
| Clemastine fumarate | 14976-57-9 | 2A-9036407 |
| Ethyl 2-bromotetradecanoate | 14980-92-8 | 2A-9036408 |
| 4,4'-Diphenoxybenzophenone | 14984-21-5 | 2A-9036409 |
| Acetylcarnitine | 14992-62-2 | 2A-9036413 |
| Mordant Blue 1 | 15012-28-9 | 2A-9036419 |
| Bis(4-hydroxyphenyl)disulfide | 15015-57-3 | 2A-9036420 |
| Mono-tert-butyl succinate | 15026-17-2 | 2A-9036422 |
| N-Benzyloxycarbonyl-D-norleucine | 15027-14-2 | 2A-9036423 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA