
CAS Number5337-79-1
Synonyms3-(4-Pyridyl)acrylic acid; trans-3-(4-pyridyl)acrylic acid; (2E)-3-(4-Pyridinyl)acrylic acid; (2E)-3-(Pyridin-4-yl)acrylic acid; (2E)-3-pyridin-4-ylacrylic acid; 4-Pyridineacrylic acid; (2E)-3-(pyridin-4-yl)prop-2-enoic acid; EINECS 226-265-4; MFCD00040746
Molecular FormulaC8H7NO2
Molecular Weight149.147
Purity98%
Density1.3±0.1 g/cm3
Boiling Point317.5±17.0 °C at 760 mmHg
Melting Point280ºC
AppearanceWhite to off-white crystalline powder
EINECS226-265-4
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5337-79-1 |
| Catalog No. | 2A-9003628 |
| Chinese Name | 3-(吡啶-4-)丙烯酸 |
| Synonyms | 3-(4-Pyridyl)acrylic acid; trans-3-(4-pyridyl)acrylic acid; (2E)-3-(4-Pyridinyl)acrylic acid; (2E)-3-(Pyridin-4-yl)acrylic acid; (2E)-3-pyridin-4-ylacrylic acid; 4-Pyridineacrylic acid; (2E)-3-(pyridin-4-yl)prop-2-enoic acid; EINECS 226-265-4; MFCD00040746 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.147 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 317.5±17.0 °C at 760 mmHg |
| Melting Point | 280ºC |
| Appearance | White to off-white crystalline powder |
| Storage Condition | Refrigerator (+4°C) |
| EINECS | 226-265-4 |
| HTC | 2933399090 |
| SMILES | O=C(O)C=Cc1ccncc1 |
| InChI | InChI=1S/C8H7NO2/c10-8(11)2-1-7-3-5-9-6-4-7/h1-6H,(H,10,11)/b2-1+ |
| InChI Key | SSAYTINUCCRGDR-OWOJBTEDSA-N |
| Hazard Symbols | Xn |
| Risk Codes | R22;R36/37/38 |
| Safety Description | S22;S26;S36/37/39 |
| MSDS | msds/3628_1_5337_79_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 3-(4-pyridyl)acrylic acid Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Hydroxyphenyl)propionic acid | 501-97-3 | 2A-9003621 |
| 3-(4-Methoxyphenyl)propanal | 20401-88-1 | 2A-9003623 |
| 3-(4-Methoxyphenyl)propionic acid | 1929-29-9 | 2A-9003624 |
| 3-(4-Nitrophenoxy)benzoic acid | 2A-103625 | 2A-9003625 |
| 3-(4-Nitrophenyl)propanoic acid | 16642-79-8 | 2A-9003626 |
| 3-(5-Amino-2-chloroanilino)-1-(2,4,6-trichlorophenyl)-5-pyrazolone | 53411-33-9 | 2A-9003629 |
| 3-(Acetylamino)-5-amino-4-hydroxybenzenesulfonic acid | 40306-75-0 | 2A-9003631 |
| 3-(Aminosulfonyl)-4-chlorobenzoyl chloride | 70049-77-3 | 2A-9003632 |
| 3-(Difluoromethoxy)aniline | 22236-08-4 | 2A-9003637 |
| 3-(Difluoromethoxy)benzoic acid | 4837-19-8 | 2A-9003639 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA