CAS Number16642-79-8
Synonyms3-(4-Nitrophenyl)propionic acid; 4-Nitrohydrocinnamic Acid; 4-nitrobenzenepropanoic acid; WNR D2VQ; 4-nitrophenylpropionic acid; MFCD00126834; para-nitrohydrocinnamic acid; 3-(4-Nitrophenyl)propanoic acid
Molecular FormulaC9H9NO5
Molecular Weight211.176
Purity98%
Density1.3±0.1 g/cm3
Boiling Point382.7±17.0 °C at 760 mmHg
Melting Point167-170°C
AppearanceWhite to off-white or yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16642-79-8 |
| Catalog No. | 2A-9003626 |
| Chinese Name | 3-(4-硝基苯基)丙酸 |
| Synonyms | 3-(4-Nitrophenyl)propionic acid; 4-Nitrohydrocinnamic Acid; 4-nitrobenzenepropanoic acid; WNR D2VQ; 4-nitrophenylpropionic acid; MFCD00126834; para-nitrohydrocinnamic acid; 3-(4-Nitrophenyl)propanoic acid |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.176 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 382.7±17.0 °C at 760 mmHg |
| Melting Point | 167-170°C |
| Appearance | White to off-white or yellow powder |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2916399090 |
| MDL Number | MFCD00045947 |
| SMILES | O=C(O)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H9NO4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-2,4-5H,3,6H2,(H,11,12) |
| InChI Key | VZOPVJNBOQOLPN-UHFFFAOYSA-N |
| MSDS | msds/3626_1_16642_79_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Fluorophenylthio)-2-hydroxy-2-methylpropanoic acid | 339530-91-5 | 2A-9003620 |
| 3-(4-Hydroxyphenyl)propionic acid | 501-97-3 | 2A-9003621 |
| 3-(4-Methoxyphenyl)propanal | 20401-88-1 | 2A-9003623 |
| 3-(4-Methoxyphenyl)propionic acid | 1929-29-9 | 2A-9003624 |
| 3-(4-Nitrophenoxy)benzoic acid | 2A-103625 | 2A-9003625 |
| 3-(4-Pyridyl)acrylic acid | 5337-79-1 | 2A-9003628 |
| 3-(5-Amino-2-chloroanilino)-1-(2,4,6-trichlorophenyl)-5-pyrazolone | 53411-33-9 | 2A-9003629 |
| 3-(Acetylamino)-5-amino-4-hydroxybenzenesulfonic acid | 40306-75-0 | 2A-9003631 |
| 3-(Aminosulfonyl)-4-chlorobenzoyl chloride | 70049-77-3 | 2A-9003632 |
| 3-(Difluoromethoxy)aniline | 22236-08-4 | 2A-9003637 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS