
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29582-31-8 |
| Catalog No. | 2A-9003614 |
| Chinese Name | 反-(4-乙氧基苯甲-3-丙烯酸 |
| Synonyms | MFCD00075337; trans-(4-Ethoxybenzoyl)-3-acrylic acid |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.227 |
| Purity | 98 |
| Density | 1.205g/cm3 |
| Boiling Point | 398.2ºC at 760mmHg |
| Melting Point | 140-144ºC |
| Appearance | Yellow crystalline powder |
| Storage Condition | Sealed in a cool, dry environment at 0-6 ºC |
| HTC | 2918990090 |
| MDL Number | MFCD00075337 |
| SMILES | CCOc1ccc(C(=O)C=CC(=O)O)cc1 |
| InChI | InChI=1S/C12H12O4/c1-2-16-10-5-3-9(4-6-10)11(13)7-8-12(14)15/h3-8H,2H2,1H3,(H,14,15)/p-1/b8-7+ |
| InChI Key | WKIKNOMECIZQHQ-BQYQJAHWSA-N |
| MSDS | msds/3614_1_29582_31_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Chlorophenyl)-2-cyanoacrylic acid | 20374-46-3 | 2A-9003605 |
| 3-(4-Chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propionic acid | 117291-25-5 | 2A-9003606 |
| 3-(4-Chlorophenyl)glutaric acid | 35271-74-0 | 2A-9003609 |
| 3-(4-Chlorophenyl)prop-2-yn-1-ol | 37614-57-6 | 2A-9003610 |
| 3-(4-Chlorophenyl)propanol | 6282-88-8 | 2A-9003612 |
| 3-(4-Fluorobenzoyl)propionic acid | 366-77-8 | 2A-9003615 |
| 3-(4-Fluorophenoxy)propionic acid | 1579-78-8 | 2A-9003617 |
| 3-(4-Fluorophenyl)propionic acid | 459-31-4 | 2A-9003619 |
| 3-(4-Fluorophenylthio)-2-hydroxy-2-methylpropanoic acid | 339530-91-5 | 2A-9003620 |
| 3-(4-Hydroxyphenyl)propionic acid | 501-97-3 | 2A-9003621 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA