
CAS Number35271-74-0
SynonymsMFCD00190249; 3-(4-Chlorophenyl)pentanedioic acid; 3-(4-chlorophenyl)-pentanedioic acid; 3-(4-chloro-phenyl)-glutaric acid; EINECS 252-477-1; QV1YR DG&1VQ; b-(4-Chlorophenyl) glutaric acid; 3-(4-chlorophenyl)pentane-1,5-dioic acid
Molecular FormulaC11H11ClO4
Molecular Weight242.656
Purity98%
Density1.4±0.1 g/cm3
Boiling Point394.4±27.0 °C at 760 mmHg
Melting Point164-166°C
Appearancewhite solid
EINECS252-477-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35271-74-0 |
| Catalog No. | 2A-9003609 |
| Chinese Name | 3-(4-氯苯基)戊二酸 |
| Synonyms | MFCD00190249; 3-(4-Chlorophenyl)pentanedioic acid; 3-(4-chlorophenyl)-pentanedioic acid; 3-(4-chloro-phenyl)-glutaric acid; EINECS 252-477-1; QV1YR DG&1VQ; b-(4-Chlorophenyl) glutaric acid; 3-(4-chlorophenyl)pentane-1,5-dioic acid |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.656 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 394.4±27.0 °C at 760 mmHg |
| Melting Point | 164-166°C |
| Appearance | white solid |
| Storage Condition | Sealed, cool and dry storage |
| EINECS | 252-477-1 |
| HTC | 2917399090 |
| SMILES | O=C(O)CC(CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClO4/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H,13,14)(H,15,16)/p-2 |
| InChI Key | URXVLIVRJJNJII-UHFFFAOYSA-N |
| MSDS | msds/3609_1_35271_74_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Benzhydrylpiperazino)-1,1,1-trifluoro-2-propanol | 2A-103601 | 2A-9003601 |
| 3-(4-Bromophenyl)-3-oxopropanenitrile | 4592-94-3 | 2A-9003603 |
| 3-(4-Carboethoxy)phenyl propanal | 151864-81-2 | 2A-9003604 |
| 3-(4-Chlorophenyl)-2-cyanoacrylic acid | 20374-46-3 | 2A-9003605 |
| 3-(4-Chlorophenyl)-3-[(2,2,2-trifluoroacetyl)amino]propionic acid | 117291-25-5 | 2A-9003606 |
| 3-(4-Chlorophenyl)prop-2-yn-1-ol | 37614-57-6 | 2A-9003610 |
| 3-(4-Chlorophenyl)propanol | 6282-88-8 | 2A-9003612 |
| 3-(4-Ethoxybenzoyl)acrylic acid | 29582-31-8 | 2A-9003614 |
| 3-(4-Fluorobenzoyl)propionic acid | 366-77-8 | 2A-9003615 |
| 3-(4-Fluorophenoxy)propionic acid | 1579-78-8 | 2A-9003617 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA