
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13403-01-5 |
| Catalog No. | 2A-9035558 |
| Chinese Name | 2-(2,4-二特戊基苯氧基)丁酸 |
| Synonyms | MFCD00045895; 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoic acid; EINECS 236-495-7 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.546 |
| Purity | 98.00 |
| Density | 0.988 g/cm3 |
| Boiling Point | 414.9ºC at 760 mmHg |
| Melting Point | 76-78ºC |
| HTC | 2918990090 |
| PubChem ID | 5906732 |
| MDL Number | MFCD00027026 |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)O |
| InChI | InChI=1S/C20H32O3/c1-8-16(18(21)22)23-17-12-11-14(19(4,5)9-2)13-15(17)20(6,7)10-3/h11-13,16H,8-10H2,1-7H3,(H,21,22) |
| InChI Key | PHCYXPLSQNMCRY-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichlorophenylhydrazine | 13123-92-7 | 2A-9035364 |
| Ethyl 2,4-dioxohexanoate | 13246-52-1 | 2A-9035452 |
| 1-(2,4-Dimethylphenyl)-3-methylthiourea | 13278-55-2 | 2A-9035471 |
| 2,4-Dimethoxyphenol | 13330-65-9 | 2A-9035506 |
| 2,4-Di(tert-amyl)phenoxyacetic acid | 13402-96-5 | 2A-9035557 |
| 1,3,8-Triazaspiro[4.5]decane-2,4-dione | 13625-39-3 | 2A-9035733 |
| 5-Bromoindole-3-butyric acid | 13993-31-2 | 2A-9035947 |
| 2-Methylbenzyl mercaptan | 14092-00-3 | 2A-9036010 |
| Ethyl ziram | 14324-55-1 | 2A-9036127 |
| 1,2,4,5-Tetrakis(dibromomethyl)benzene | 14939-02-7 | 2A-9036399 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA