
CAS Number13246-52-1
SynonymsHexanoic acid, 2,4-dioxo-, ethyl ester; 2,4-dioxo-hexanoic acid; 2,4-Dioxohexanoic acid,ethyl ester; Ethyl 2,4-dioxohexanoate; Ethyl propionyl pyruvate; Ethyl 2,4-diketocaproate; EINECS 236-228-4; Hexanoic acid,2,4-dioxo-,ethyl ester; 2,4-Dioxo-hexansaeure-aethylester; Propionylbrenztraubensaeure-aethylester; FEMA No. 3278
Molecular FormulaC8H12O4
Molecular Weight172.18
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point233.8±13.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13246-52-1 |
| Catalog No. | 2A-9035452 |
| Chinese Name | 2,4-二氧代己酸乙酯 |
| Synonyms | Hexanoic acid, 2,4-dioxo-, ethyl ester; 2,4-dioxo-hexanoic acid; 2,4-Dioxohexanoic acid,ethyl ester; Ethyl 2,4-dioxohexanoate; Ethyl propionyl pyruvate; Ethyl 2,4-diketocaproate; EINECS 236-228-4; Hexanoic acid,2,4-dioxo-,ethyl ester; 2,4-Dioxo-hexansaeure-aethylester; Propionylbrenztraubensaeure-aethylester; FEMA No. 3278 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 233.8±13.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918300090 |
| PubChem ID | 3718523 |
| SMILES | CCOC(=O)C(=O)CC(=O)CC |
| InChI | InChI=1S/C8H12O4/c1-3-6(9)5-7(10)8(11)12-4-2/h3-5H2,1-2H3 |
| InChI Key | JGFBKJBAYISHAG-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 1-(2,4-Dihydroxy-3-methylphenyl)ethan-1-one | 10139-84-1 | 2A-9034681 |
| N-(2,4-Dinitrophenyl)-L-alanine methyl ester | 10420-63-0 | 2A-9034870 |
| N-(2,4-Dinitrophenyl)-6-aminohexanoic acid | 10466-72-5 | 2A-9034895 |
| 3-Methoxy-2,4,5-trifluorobenzoic acid | 11281-65-5 | 2A-9035011 |
| 2,4-Dichlorophenylhydrazine | 13123-92-7 | 2A-9035364 |
| 1-(2,4-Dimethylphenyl)-3-methylthiourea | 13278-55-2 | 2A-9035471 |
| 2,4-Dimethoxyphenol | 13330-65-9 | 2A-9035506 |
| 2,4-Di(tert-amyl)phenoxyacetic acid | 13402-96-5 | 2A-9035557 |
| 2-(2,4-Di-tert-pentylphenoxy)butryic acid | 13403-01-5 | 2A-9035558 |
| 1,3,8-Triazaspiro[4.5]decane-2,4-dione | 13625-39-3 | 2A-9035733 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA