
CAS Number13402-96-5
Synonyms2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetic acid; EINECS 236-494-1; MFCD00128799; 2,4-Di(tert-pentyl)phenoxyacetic acid; 2-(2,4-Di-tert-pentylphenoxy)acetic acid
Molecular FormulaC18H28O3
Molecular Weight292.41300
Purity98.00%
Density1.004g/cm3
Boiling Point391.1ºC at 760mmHg
Melting Point125-127 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13402-96-5 |
| Catalog No. | 2A-9035557 |
| Chinese Name | 2,4-二(叔-戊基)苯氧基乙酸 |
| Synonyms | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetic acid; EINECS 236-494-1; MFCD00128799; 2,4-Di(tert-pentyl)phenoxyacetic acid; 2-(2,4-Di-tert-pentylphenoxy)acetic acid |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.41300 |
| Purity | 98.00 |
| Density | 1.004g/cm3 |
| Boiling Point | 391.1ºC at 760mmHg |
| Melting Point | 125-127 °C(lit.) |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| HTC | 2918990090 |
| PubChem ID | 6381419 |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C18H28O3/c1-7-17(3,4)13-9-10-15(21-12-16(19)20)14(11-13)18(5,6)8-2/h9-11H,7-8,12H2,1-6H3,(H,19,20)/p-1 |
| InChI Key | QXQMENSTZKYZCE-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 3-Methoxy-2,4,5-trifluorobenzoic acid | 11281-65-5 | 2A-9035011 |
| 2,4-Dichlorophenylhydrazine | 13123-92-7 | 2A-9035364 |
| Ethyl 2,4-dioxohexanoate | 13246-52-1 | 2A-9035452 |
| 1-(2,4-Dimethylphenyl)-3-methylthiourea | 13278-55-2 | 2A-9035471 |
| 2,4-Dimethoxyphenol | 13330-65-9 | 2A-9035506 |
| 2-(2,4-Di-tert-pentylphenoxy)butryic acid | 13403-01-5 | 2A-9035558 |
| 1,3,8-Triazaspiro[4.5]decane-2,4-dione | 13625-39-3 | 2A-9035733 |
| 5-Bromoindole-3-butyric acid | 13993-31-2 | 2A-9035947 |
| 2-Methylbenzyl mercaptan | 14092-00-3 | 2A-9036010 |
| Ethyl ziram | 14324-55-1 | 2A-9036127 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA