CAS Number13171-64-7
Synonyms(+)-Dimethyl-L-tartrate; (−)-Dimethyl D-tartrate; EINECS 236-118-6; dimethyl (2S,3S)-2,3-dihydroxybutanedioate; D-(-)-Tartaric Acid Dimethyl Ester; DIMETHYL TARTRATE (MESO); D-(−)-Tartaric acid dimethyl ester; Dimethyl D-tartrate; Dimethyl D-(-)-Tartrate; Dimethyl (2R,3R)-2,3-dihydroxysuccinate; Dimethyl (2S,3S)-2,3-dihydroxysuccinate; meso-tartaric acid, dimethyl ester; Dimethyl-D-tartrate; MFCD00008445
Molecular FormulaC6H10O6
Molecular Weight218.20
Purity98%
Density1.4±0.1 g/cm3
Boiling Point80-82 °C/0.1 mmHg (lit.)
Melting Point48-50ºC
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13171-64-7 |
| Catalog No. | 2A-9035400 |
| Chinese Name | D-(-)-酒石酸二甲酯 |
| Synonyms | (+)-Dimethyl-L-tartrate; (−)-Dimethyl D-tartrate; EINECS 236-118-6; dimethyl (2S,3S)-2,3-dihydroxybutanedioate; D-(-)-Tartaric Acid Dimethyl Ester; DIMETHYL TARTRATE (MESO); D-(−)-Tartaric acid dimethyl ester; Dimethyl D-tartrate; Dimethyl D-(-)-Tartrate; Dimethyl (2R,3R)-2,3-dihydroxysuccinate; Dimethyl (2S,3S)-2,3-dihydroxysuccinate; meso-tartaric acid, dimethyl ester; Dimethyl-D-tartrate; MFCD00008445 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 218.20 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 80-82 °C/0.1 mmHg (lit.) |
| Melting Point | 48-50ºC |
| Appearance | liquid |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| HTC | 29181300 |
| PubChem ID | 24863661 |
| MDL Number | MFCD00040504 |
| SMILES | COC(=O)[C@H]1OC(C)(C)O[C@@H]1C(=O)OC |
| InChI | 1S/C9H14O6/c1-9(2)14-5(7(10)12-3)6(15-9)8(11)13-4/h5-6H,1-4H3/t5-,6-/m0/s1 |
| InChI Key | ROZOUYVVWUTPNG-WDSKDSINSA-N |
| Beilstein/REAXYS | 3548490 |
| NACRES Code | NA.22 |
| UNSPSC | 12352005 |
| MSDS | msds/35400_1_13171_64_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Methyl-benzoylhydrazide | 13050-47-0 | 2A-9035305 |
| 2-Methyl-5-(trifluoromethyl)benzoic acid | 13055-63-5 | 2A-9035309 |
| Bromomethyl methyl ether | 13057-17-5 | 2A-9035310 |
| Methylboronic acid | 13061-96-6 | 2A-9035316 |
| trans-4-Methylcyclohexanecarboxylic acid | 13064-83-0 | 2A-9035320 |
| 1,2-Bis(dibromomethyl)benzene | 13209-15-9 | 2A-9035427 |
| Glycidaldehyde diethylacetal | 13269-77-7 | 2A-9035467 |
| 3-Nitrophenylboronic acid | 13331-27-6 | 2A-9035508 |
| 2-(Trifluoromethyl)thiophenol | 13333-97-6 | 2A-9035510 |
| 2-(Trifluoromethyl)phenylthioacetic acid | 13334-00-4 | 2A-9035511 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS