
CAS Number13055-63-5
Synonyms2-Methyl-5-(trifluoromethyl)benzoic acid; QVR B1 EXFFF; MFCD01631589
Molecular FormulaC9H7F3O2
Molecular Weight204.15
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point261.0±40.0 °C at 760 mmHg
Melting Point123-125°C
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13055-63-5 |
| Catalog No. | 2A-9035309 |
| Chinese Name | 2-甲基-5-(三氟甲基)苯甲酸 |
| Synonyms | 2-Methyl-5-(trifluoromethyl)benzoic acid; QVR B1 EXFFF; MFCD01631589 |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.15 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 261.0±40.0 °C at 760 mmHg |
| Melting Point | 123-125°C |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Sealed and protected from light at room temperatur |
| HTC | 2916399090 |
| PubChem ID | 3211553 |
| SMILES | Cc1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C9H7F3O2/c1-5-2-3-6(9(10,11)12)4-7(5)8(13)14/h2-4H,1H3,(H,13,14) |
| InChI Key | STJUSBSLJXOSDU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4'-Fluorobiphenyl-3-carboxylic acid | 10540-39-3 | 2A-9034934 |
| 5-Acetoxymethyl-2-furaldehyde | 10551-58-3 | 2A-9034943 |
| 3-((E)-3-ETHOXY-3-OXO-1-PROPEN-1-YL)BENZENEBORONIC ACID 98 | 913835-51-5 | 2A-9035040 |
| Ferrocenecarboxaldehyde | 12093-10-6 | 2A-9035077 |
| 3-Methyl-benzoylhydrazide | 13050-47-0 | 2A-9035305 |
| Bromomethyl methyl ether | 13057-17-5 | 2A-9035310 |
| Methylboronic acid | 13061-96-6 | 2A-9035316 |
| trans-4-Methylcyclohexanecarboxylic acid | 13064-83-0 | 2A-9035320 |
| (-)-Dimethyl D-tartrate | 13171-64-7 | 2A-9035400 |
| 1,2-Bis(dibromomethyl)benzene | 13209-15-9 | 2A-9035427 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA