CAS Number13331-27-6
Synonyms3-Nitrophenylboronic acid; (3-Nitrophenyl)boronic acid; MFCD00007193; 3-Nitrobenzeneboronic acid
Molecular FormulaO2NC6H4B(OH)2
Molecular Weight166.93
Purity≥97%
Density1.4±0.1 g/cm3
Boiling Point363.3±44.0 °C at 760 mmHg
Melting Point284-285 °C (dec.) (lit.)
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13331-27-6 |
| Catalog No. | 2A-9035508 |
| Chinese Name | 3-硝基苯硼酸 |
| Synonyms | 3-Nitrophenylboronic acid; (3-Nitrophenyl)boronic acid; MFCD00007193; 3-Nitrobenzeneboronic acid |
| Molecular Formula | O2NC6H4B(OH)2 |
| Molecular Weight | 166.93 |
| Purity | ≥97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 363.3±44.0 °C at 760 mmHg |
| Melting Point | 284-285 °C (dec.) (lit.) |
| Appearance | powder |
| Water Solubility | soluble in hot water |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| Application | 3-Nitrophenylboronic acid is a biochemical reagent that can be used as a biological material or organic compound for life science-related research. |
| HTC | 29310095 |
| PubChem ID | 24859487 |
| MDL Number | MFCD00007193 |
| SMILES | OB(O)c1cccc(c1)[N+]([O-])=O |
| InChI | 1S/C6H6BNO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,9-10H |
| InChI Key | ZNRGSYUVFVNSAW-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2938638 |
| NACRES Code | NA.22 |
| UNSPSC | 12352103 |
| MSDS | msds/35508_1_13331_27_6.pdf |
| Bioactivity | Chemical & Physical Properties |
| Use of | 3-Nitrophenylboronic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. Properties Articles16 Biological Activity Chemical & Physical Properties |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: 3-Nitrophenylboronic acid (contains varying amounts of anhydride) |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Methylboronic acid | 13061-96-6 | 2A-9035316 |
| trans-4-Methylcyclohexanecarboxylic acid | 13064-83-0 | 2A-9035320 |
| (-)-Dimethyl D-tartrate | 13171-64-7 | 2A-9035400 |
| 1,2-Bis(dibromomethyl)benzene | 13209-15-9 | 2A-9035427 |
| Glycidaldehyde diethylacetal | 13269-77-7 | 2A-9035467 |
| 2-(Trifluoromethyl)thiophenol | 13333-97-6 | 2A-9035510 |
| 2-(Trifluoromethyl)phenylthioacetic acid | 13334-00-4 | 2A-9035511 |
| 4-Amino-1-cyclohexene-1-carboxylic acid | 13372-08-2 | 2A-9035546 |
| 3-Phenylacrylaldehyde oxime | 13372-81-1 | 2A-9035547 |
| 5,6-Dihydro-2H-pyran-3-carbaldehyde | 13417-49-7 | 2A-9035567 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS