
CAS Number636-93-1
Synonyms5-nitro-2-methoxyphenol; 5-nitroguaiacol; Phenol,2-methoxy-5-nitro; 2-Methoxy-5-nitro-phenol; MFCD00015561; 2-Methoxy-5-nitrophenol; 3-HYDROXY-4-METHOXYNITROBENZENE; 2-Methoxy-5-nitrophe; 2-Methoxy-5-nitrobenzolol; EINECS 211-269-0; 2-Hydroxy-4-nitroanisole
Molecular FormulaCH3OC6H3(SO2NH2)CO2CH3
Molecular Weight245.25
Purity98%
Density1.4±0.1 g/cm3
Boiling Point291.0±0.0 °C at 760 mmHg
Melting Point175-177 °C (lit.)
AppearanceWhite to off-white solid
EINECS251-358-1
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 636-93-1 |
| Catalog No. | 2A-9003342 |
| Chinese Name | 5-硝基愈创木酚 |
| Synonyms | 5-nitro-2-methoxyphenol; 5-nitroguaiacol; Phenol,2-methoxy-5-nitro; 2-Methoxy-5-nitro-phenol; MFCD00015561; 2-Methoxy-5-nitrophenol; 3-HYDROXY-4-METHOXYNITROBENZENE; 2-Methoxy-5-nitrophe; 2-Methoxy-5-nitrobenzolol; EINECS 211-269-0; 2-Hydroxy-4-nitroanisole |
| Molecular Formula | CH3OC6H3(SO2NH2)CO2CH3 |
| Molecular Weight | 245.25 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 291.0±0.0 °C at 760 mmHg |
| Melting Point | 175-177 °C (lit.) |
| Appearance | White to off-white solid |
| Storage Condition | Store in a sealed container in a cool, dry place. |
| Packaging | III |
| EINECS | 251-358-1 |
| HTC | 29095090 |
| PubChem ID | 24874260 |
| MDL Number | MFCD01317542 |
| SMILES | COC(=O)c1cc(ccc1OC)S(N)(=O)=O |
| InChI | 1S/C9H11NO5S/c1-14-8-4-3-6(16(10,12)13)5-7(8)9(11)15-2/h3-5H,1-2H3,(H2,10,12,13) |
| InChI Key | MKDYDRQLKPGNNU-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/3342_1_636_93_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methoxy-4-nitroaniline | 97-52-9 | 2A-9003336 |
| 2-Methoxy-5-(2-oxo-propyl)benzenesulfonamide | 116091-63-5 | 2A-9003338 |
| 2-Methoxy-5-methylaniline | 120-71-8 | 2A-9003339 |
| 2-Methoxy-5-methyl-N,N-bis(1-methylethyl)-3-phenylbenzene propanaminefumarate | 124935-89-3 | 2A-9003340 |
| 2-Methoxy-5-methylsulfonylbenzoic acid | 50390-76-6 | 2A-9003341 |
| 2-Methoxyacetophenone | 4079-52-1 | 2A-9003347 |
| 2-Methoxybenzonitrile | 6609-56-9 | 2A-9003348 |
| 2-Methoxybenzoyl chloride | 21615-34-9 | 2A-9003349 |
| 2-Methoxycarbonylmethoxyimino-4-chloro-3-oxobutyric acid | 84080-70-6 | 2A-9003350 |
| 2-Methoxyethyl 2-(3-nitrobenzylidene)acetoacetate | 39562-22-6 | 2A-9003351 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA