
CAS Number50390-76-6
Synonyms2-Methoxy-5-(methylsulfonyl)benzoic acid; 2-Methoxyl-5-methysulfonyl benzoic acid; EINECS 256-573-4; 2-methoxy-5-methylsulfonylbenzoic acid; MFCD01317544
Molecular FormulaC9H10O5S
Molecular Weight230.238
Purity98%
Density1.4±0.1 g/cm3
Boiling Point467.9±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50390-76-6 |
| Catalog No. | 2A-9003341 |
| Chinese Name | 2-甲氧基-5-甲砜基苯甲酸 |
| Synonyms | 2-Methoxy-5-(methylsulfonyl)benzoic acid; 2-Methoxyl-5-methysulfonyl benzoic acid; EINECS 256-573-4; 2-methoxy-5-methylsulfonylbenzoic acid; MFCD01317544 |
| Molecular Formula | C9H10O5S |
| Molecular Weight | 230.238 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 467.9±45.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| SMILES | COc1ccc(S(C)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C9H10O5S/c1-14-8-4-3-6(15(2,12)13)5-7(8)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChI Key | BXWLVQXAFBWKSR-UHFFFAOYSA-N |
| MSDS | msds/3341_1_50390_76_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methoxy-4-chlorobenzoic acid | 57479-70-6 | 2A-9003335 |
| 2-Methoxy-4-nitroaniline | 97-52-9 | 2A-9003336 |
| 2-Methoxy-5-(2-oxo-propyl)benzenesulfonamide | 116091-63-5 | 2A-9003338 |
| 2-Methoxy-5-methylaniline | 120-71-8 | 2A-9003339 |
| 2-Methoxy-5-methyl-N,N-bis(1-methylethyl)-3-phenylbenzene propanaminefumarate | 124935-89-3 | 2A-9003340 |
| 2-Methoxy-5-nitrophenol | 636-93-1 | 2A-9003342 |
| 2-Methoxyacetophenone | 4079-52-1 | 2A-9003347 |
| 2-Methoxybenzonitrile | 6609-56-9 | 2A-9003348 |
| 2-Methoxybenzoyl chloride | 21615-34-9 | 2A-9003349 |
| 2-Methoxycarbonylmethoxyimino-4-chloro-3-oxobutyric acid | 84080-70-6 | 2A-9003350 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA