
CAS Number57479-70-6
Synonyms4-Chloro-o-anisic acid; 4-Chloro-2-methoxybenzoic acid; 4-chloro-2-methoxyphenylcarboxylic acid; 2-Methoxy-4-Chloro Benzoic Acid; 4-Chloro-ortho-anisic acid; 4-Chloro-2-methoxybenzoicacid; MFCD00002532; EINECS 260-761-1; 4-chloro-o-anis acid
Molecular FormulaCH3OC6H3(CH3)B(OH)2
Molecular Weight165.98
Purity≥95%
Density1.4±0.1 g/cm3
Boiling Point314.7±22.0 °C at 760 mmHg
Melting Point169-174 °C (lit.)
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57479-70-6 |
| Catalog No. | 2A-9003335 |
| Chinese Name | 2-甲氧基-4-氯苯甲酸 |
| Synonyms | 4-Chloro-o-anisic acid; 4-Chloro-2-methoxybenzoic acid; 4-chloro-2-methoxyphenylcarboxylic acid; 2-Methoxy-4-Chloro Benzoic Acid; 4-Chloro-ortho-anisic acid; 4-Chloro-2-methoxybenzoicacid; MFCD00002532; EINECS 260-761-1; 4-chloro-o-anis acid |
| Molecular Formula | CH3OC6H3(CH3)B(OH)2 |
| Molecular Weight | 165.98 |
| Purity | ≥95 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 314.7±22.0 °C at 760 mmHg |
| Melting Point | 169-174 °C (lit.) |
| Appearance | powder |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2918990090 |
| PubChem ID | 24883021 |
| MDL Number | MFCD02684315 |
| SMILES | COc1ccc(B(O)O)c(C)c1 |
| InChI | 1S/C8H11BO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5,10-11H,1-2H3 |
| InChI Key | AMSQNQJCBXQYEX-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352103 |
| MSDS | msds/3335_1_57479_70_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Mercapto-6-(methoxymethyl)pyrimidin-4-ol | 175205-07-9 | 2A-9003321 |
| 2-Mercapto-6-methylpyrimidin-4-ol | 2A-103322 | 2A-9003322 |
| 2-Mercapto-6-propylpyrimidin-4-ol | 53939-84-7 | 2A-9003323 |
| 2-Mercaptonicotinic acid | 38521-46-9 | 2A-9003326 |
| 2-Methanesulfonyl-4-nitrophenylamine | 96-74-2 | 2A-9003330 |
| 2-Methoxy-4-nitroaniline | 97-52-9 | 2A-9003336 |
| 2-Methoxy-5-(2-oxo-propyl)benzenesulfonamide | 116091-63-5 | 2A-9003338 |
| 2-Methoxy-5-methylaniline | 120-71-8 | 2A-9003339 |
| 2-Methoxy-5-methyl-N,N-bis(1-methylethyl)-3-phenylbenzene propanaminefumarate | 124935-89-3 | 2A-9003340 |
| 2-Methoxy-5-methylsulfonylbenzoic acid | 50390-76-6 | 2A-9003341 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA