
CAS Number39562-22-6
Synonyms2-methoxyethyl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate; EINECS 254-511-0; MFCD00521048; 2-Methoxyethyl (4E)-5-(3-nitrophenyl)-3-oxo-4-pentenoate; 2-Methoxyethyl (2E)-2-(3-nitrobenzylidene)-3-oxobutanoate; 2-Methoxyethyl 2-(3-nitrobenzylidene)-3-oxobutanoate
Molecular FormulaC22H19N3O6S2
Molecular Weight485.541
Purity99%
Density1.3±0.1 g/cm3
Boiling Point467.2±40.0 °C at 760 mmHg
Melting Point72-74ºC
Appearancea white crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39562-22-6 |
| Catalog No. | 2A-9003351 |
| Chinese Name | 3-硝基苯叉基乙酰乙酸甲氧乙酯 |
| Synonyms | 2-methoxyethyl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate; EINECS 254-511-0; MFCD00521048; 2-Methoxyethyl (4E)-5-(3-nitrophenyl)-3-oxo-4-pentenoate; 2-Methoxyethyl (2E)-2-(3-nitrobenzylidene)-3-oxobutanoate; 2-Methoxyethyl 2-(3-nitrobenzylidene)-3-oxobutanoate |
| Molecular Formula | C22H19N3O6S2 |
| Molecular Weight | 485.541 |
| Purity | 99 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 467.2±40.0 °C at 760 mmHg |
| Melting Point | 72-74ºC |
| Appearance | a white crystal |
| Storage Condition | Refrigerator |
| HTC | 2918300090 |
| MDL Number | MFCD03932939 |
| SMILES | COCCOC(=O)C(=Cc1cccc([N+](=O)[O-])c1)C(C)=O |
| InChI | InChI=1S/C14H15NO6/c1-10(16)13(14(17)21-7-6-20-2)9-11-4-3-5-12(8-11)15(18)19/h3-5,8-9H,6-7H2,1-2H3/b13-9+ |
| InChI Key | UVZJPCAZMGLNTB-UHFFFAOYSA-N |
| MSDS | msds/3351_1_39562_22_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methoxy-5-nitrophenol | 636-93-1 | 2A-9003342 |
| 2-Methoxyacetophenone | 4079-52-1 | 2A-9003347 |
| 2-Methoxybenzonitrile | 6609-56-9 | 2A-9003348 |
| 2-Methoxybenzoyl chloride | 21615-34-9 | 2A-9003349 |
| 2-Methoxycarbonylmethoxyimino-4-chloro-3-oxobutyric acid | 84080-70-6 | 2A-9003350 |
| 2-Methoxyethyl acetate | 110-49-6 | 2A-9003352 |
| 2-Methoxynicotinic acid | 16498-81-0 | 2A-9003354 |
| 2-Methoxyphenothiazine | 1771-18-2 | 2A-9003355 |
| 2-Methoxyphenylacetic acid | 93-25-4 | 2A-9003356 |
| 2-Methoxypropene | 116-11-0 | 2A-9003358 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA