CAS Number6836-21-1
Synonyms7-METHOXY-1-NAPHTHALENEACETIC ACID ETHYL ESTER; (7-Methoxy-[1]naphthyl)-essigsaeure-aethylester; 2-(7-methoxynaphthalen-1-yl) acetic acid ethyl ester; Ethyl (7-methoxy-1-naphthyl)acetate; ethyl 7-methoxy-1-naphthaleneacetate; ethyl (7-methoxynaphth-1-yl)acetate; 1-Naphthaleneacetic acid, 7-methoxy-, ethyl ester; Ethyl (7-methoxynaphthalen-1-yl)acetate; (7-methoxy-[1]naphthyl)-acetic acid ethyl ester
Molecular FormulaC15H16O3
Molecular Weight244.29
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point370.4±17.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6836-21-1 |
| Catalog No. | 2A-9033172 |
| Chinese Name | 7-甲氧基-1-萘基乙酸乙酯 |
| Synonyms | 7-METHOXY-1-NAPHTHALENEACETIC ACID ETHYL ESTER; (7-Methoxy-[1]naphthyl)-essigsaeure-aethylester; 2-(7-methoxynaphthalen-1-yl) acetic acid ethyl ester; Ethyl (7-methoxy-1-naphthyl)acetate; ethyl 7-methoxy-1-naphthaleneacetate; ethyl (7-methoxynaphth-1-yl)acetate; 1-Naphthaleneacetic acid, 7-methoxy-, ethyl ester; Ethyl (7-methoxynaphthalen-1-yl)acetate; (7-methoxy-[1]naphthyl)-acetic acid ethyl ester |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 370.4±17.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918990090 |
| MDL Number | MFCD12756805 |
| SMILES | CCOC(=O)Cc1cccc2ccc(OC)cc12 |
| InChI Key | VPXDDUIYFMKQBI-UHFFFAOYSA-N |
| MSDS | msds/33172_1_6836_21_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 6-Chloro-2,4-dimethoxypyrimidine | 6320-15-6 | 2A-9032746 |
| 2,4-Dimethylphenylacetic acid | 6331-04-0 | 2A-9032763 |
| 2,4-Diphenyl-4-methyl-1-pentene | 6362-80-7 | 2A-9032811 |
| Diquat dibromide monohydrate | 6385-62-2 | 2A-9032842 |
| 2,4-Dichloro-6-morpholino-1,3,5-triazine | 6601-22-5 | 2A-9033002 |
| 7-Methoxy-1-naphthaleneacetic acid | 6836-22-2 | 2A-9033173 |
| 1-Chloro-2,4-dimethoxybenzene | 7051-13-0 | 2A-9033370 |
| 2,4-Dimethoxy-6-methylbenzaldehyde | 7149-90-8 | 2A-9033443 |
| 2,4-Dimethyloxazole | 7208-05-1 | 2A-9033490 |
| Ethyl 2,4-dimethylthiazole-5-carboxylate | 7210-77-7 | 2A-9033494 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS