
CAS Number6331-04-0
Synonyms(2,5-Dimethylphenyl)acetic acid; EINECS 237-097-6; MFCD00014369; (2,4-Dimethylphenyl)acetic acid; 2-(2,4-dimethylphenyl)acetic acid
Molecular FormulaC10H12O2
Molecular Weight164.2
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point295.1±9.0 °C at 760 mmHg
Melting Point128-132ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6331-04-0 |
| Catalog No. | 2A-9032763 |
| Chinese Name | 2,4-二甲基苯乙酸 |
| Synonyms | (2,5-Dimethylphenyl)acetic acid; EINECS 237-097-6; MFCD00014369; (2,4-Dimethylphenyl)acetic acid; 2-(2,4-dimethylphenyl)acetic acid |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.2 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 295.1±9.0 °C at 760 mmHg |
| Melting Point | 128-132ºC |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2916399090 |
| MDL Number | MFCD02664685 |
| SMILES | Cc1ccc(CC(=O)O)c(C)c1 |
| InChI | InChI=1S/C10H12O2/c1-7-3-4-9(6-10(11)12)8(2)5-7/h3-5H,6H2,1-2H3,(H,11,12) |
| InChI Key | MWBXCWLRASBZFB-UHFFFAOYSA-N |
| MSDS | msds/32763_1_6331_04_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 4-Methoxybenzylmercaptan | 6258-60-2 | 2A-9032630 |
| 2-Thenylmercaptan | 6258-63-5 | 2A-9032631 |
| 4-Chlorobenzylmercaptan | 6258-66-8 | 2A-9032632 |
| Methyl 2,4-dichloropyrimidine-6-carboxylate | 6299-85-0 | 2A-9032701 |
| 6-Chloro-2,4-dimethoxypyrimidine | 6320-15-6 | 2A-9032746 |
| 2,4-Diphenyl-4-methyl-1-pentene | 6362-80-7 | 2A-9032811 |
| Diquat dibromide monohydrate | 6385-62-2 | 2A-9032842 |
| 2,4-Dichloro-6-morpholino-1,3,5-triazine | 6601-22-5 | 2A-9033002 |
| 7-Methoxy-1-naphthaleneacetic acid ethyl ester | 6836-21-1 | 2A-9033172 |
| 7-Methoxy-1-naphthaleneacetic acid | 6836-22-2 | 2A-9033173 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA