CAS Number7210-77-7
SynonymsEthyl 2,4-dimethyl-1,3-thiazole-5-carboxylate; 5-Thiazolecarboxylic acid, 2,4-dimethyl-, ethyl ester; MFCD00052874
Molecular FormulaC8H11O2N1S1
Molecular Weight185.25
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point254.3±20.0 °C at 760 mmHg
Melting Point48-50 °C
AppearanceOff-white to yellow powder or chunks
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7210-77-7 |
| Catalog No. | 2A-9033494 |
| Chinese Name | 2,4-二甲基噻唑-5-甲酸乙酯 |
| Synonyms | Ethyl 2,4-dimethyl-1,3-thiazole-5-carboxylate; 5-Thiazolecarboxylic acid, 2,4-dimethyl-, ethyl ester; MFCD00052874 |
| Molecular Formula | C8H11O2N1S1 |
| Molecular Weight | 185.25 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 254.3±20.0 °C at 760 mmHg |
| Melting Point | 48-50 °C |
| Appearance | Off-white to yellow powder or chunks |
| Storage Condition | Seal in a cool, dry place. |
| HTC | 2934100090 |
| MDL Number | MFCD00052874 |
| SMILES | CCOC(=O)c1sc(C)nc1C |
| InChI | InChI=1S/C8H11NO2S/c1-4-11-8(10)7-5(2)9-6(3)12-7/h4H2,1-3H3 |
| InChI Key | BXOIIRQIGYJTTB-UHFFFAOYSA-N |
| MSDS | msds/33494_1_7210_77_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 7-Methoxy-1-naphthaleneacetic acid ethyl ester | 6836-21-1 | 2A-9033172 |
| 7-Methoxy-1-naphthaleneacetic acid | 6836-22-2 | 2A-9033173 |
| 1-Chloro-2,4-dimethoxybenzene | 7051-13-0 | 2A-9033370 |
| 2,4-Dimethoxy-6-methylbenzaldehyde | 7149-90-8 | 2A-9033443 |
| 2,4-Dimethyloxazole | 7208-05-1 | 2A-9033490 |
| 2,4-Dimethoxybenzyl alcohol | 7314-44-5 | 2A-9033548 |
| 5-Amino-2,4-dichloropyridine | 7321-93-9 | 2A-9033555 |
| 6-Phenyl-1,3,5-triazine-2,4-diol | 7459-63-4 | 2A-9033707 |
| Metaldehyde | 9002-91-9 | 2A-9034393 |
| Dicamba potassium salt | 10007-85-9 | 2A-9034529 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS