
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 610-93-5 |
| Catalog No. | 2A-9032519 |
| Chinese Name | 6-硝基四氯苯酞 |
| Synonyms | MFCD00033529; 6-nitro-3H-2-benzofuran-1-one |
| Molecular Formula | C8H5NO4 |
| Molecular Weight | 179.13000 |
| Purity | 98.00 |
| Density | 1.519g/cm3 |
| Boiling Point | 413.4ºC at 760 mmHg |
| Melting Point | 140-145 °C(lit.) |
| Appearance | Light yellow crystalline powder |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2932209090 |
| SMILES | O=C1OCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C8H5NO4/c10-8-7-3-6(9(11)12)2-1-5(7)4-13-8/h1-3H,4H2 |
| InChI Key | RNWGZXAHUPFXLL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Trigonelline hydrochloride | 6138-41-6 | 2A-9032506 |
| Methyl 3-methyl-2-furoate | 6141-57-7 | 2A-9032511 |
| 5-Norbornen-2-yl acetate | 6143-29-9 | 2A-9032514 |
| 3-Chlorophenylguanidine | 6145-41-1 | 2A-9032515 |
| Tris(2-chloropropyl) phosphate | 6145-73-9 | 2A-9032516 |
| Ethyl potassium malonate | 6148-64-7 | 2A-9032521 |
| Sodium mesitylenesulfonate | 6148-75-0 | 2A-9032522 |
| Sodium diphenylamine-4-sulfonate | 6152-67-6 | 2A-9032528 |
| (Z)-3-Methylpent-2-en-4-yn-1-ol | 6153-05-5 | 2A-9032529 |
| Mebhydrolin napadisylate | 6153-33-9 | 2A-9032532 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA