
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5945-50-6 |
| Catalog No. | 2A-9032339 |
| Chinese Name | 水晶兰苷 |
| Synonyms | Morinda officinalis How |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.34 |
| Purity | 98.00 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 717.6±60.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| Application | Monotropein is derived from Morinda officinalis. Monotropein inhibits the expression of inflammatory factors in a mouse model of dextran sulfate sodium sulfate-induced colitis. |
| MDL Number | MFCD00238650 |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)[C@@](O[C@H]2[C@@]([C@](CO)(O)C=C3)([H])[C@@]3([H])C(C(O)=O)=CO2)([H])O[C@@H]1CO |
| InChI | 1S/C16H22O10/c17-3-7-5-24-14(10-8(7)1-2-16(10,23)6-19)26-15-13(22)12(21)11(20)9(4-18)25-15/h1-3,5,8-15,18-23H,4,6H2/t8-,9-,10-,11-,12+,13-,14+,15+,16+/m1/s1 |
| InChI Key | CYYIGLDAAXXQAI-PSWNKMJPSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/32339_1_5945_50_6.pdf |
| Transport Info | Product Name: Crystal Cyanoside |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| L-Histidine hydrochloride monohydrate | 5934-29-2 | 2A-0202178 |
| Darutigenol | 5940-00-1 | 2A-9032334 |
| sec-Butyl disulfide | 5943-30-6 | 2A-9032336 |
| Diisopropyl trisulphide | 5943-34-0 | 2A-9032337 |
| Bisphenol-A bis(diphenyl phosphate) | 5945-33-5 | 2A-9032338 |
| Citric acid monohydrate | 5949-29-1 | 2A-0201578 |
| 2-Methylbenzoyl cyanide | 5955-73-7 | 2A-9032346 |
| Bredemolic acid | 5957-40-4 | 2A-9032347 |
| Carnosol | 5957-80-2 | 2A-9032348 |
| L-2-Aminobutyric acid hydrochloride | 5959-29-5 | 2A-9032349 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA