
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5575-21-3 |
| Catalog No. | 2A-9031980 |
| Chinese Name | 头孢洛宁 |
| Synonyms | Cephalonium; Cefalonum; Cefalonio [INN-Spanish]; Cefalonium [INN-Latin]; Cefalonium Hydrate; CEFALONIUM; EINECS 226-948-7 |
| Molecular Formula | C20H18N4O5S2 |
| Molecular Weight | 458.51 (anhydrous basis) |
| Purity | 98.00 |
| Melting Point | 147-150° (dec) |
| Storage Condition | 2-8°C |
| Application | Cephalonide is the first-generation β-lactam cephalosporin antibiotic, which is widely used to study mastitis caused by Gram-positive bacteria including Staphylococcus aureus [1][2][3]. |
| EINECS | 226-948-7 |
| PubChem ID | 329754381 |
| MDL Number | MFCD11975221 |
| SMILES | O.NC(=O)c1cc[n+](CC2=C(N3[C@H](SC2)[C@H](NC(=O)Cc4cccs4)C3=O)C([O-])=O)cc1 |
| InChI | 1S/C20H18N4O5S2.H2O/c21-17(26)11-3-5-23(6-4-11)9-12-10-31-19-15(18(27)24(19)16(12)20(28)29)22-14(25)8-13-2-1-7-30-13;/h1-7,15,19H,8-10H2,(H3-,21,22,25,26,28,29);1H2/t15-,19-;/m1./s1 |
| InChI Key | GVIOXNHDFXYYMP-AEFICSSHSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/31980_1_5575_21_3.pdf |
| Transport Info | Product Name: Cephemium |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| O-(2-Chlorobenzyl)hydroxylamine hydrochloride | 5555-48-6 | 2A-9031968 |
| L-Alanine benzyl ester hydrochloride | 5557-83-5 | 2A-9031969 |
| cis-11-Eicosenoic acid | 5561-99-9 | 2A-9031973 |
| Estradiene dione-3-keta | 5571-36-8 | 2A-9031978 |
| Tetrabutylammonium phosphate | 5574-97-0 | 2A-9031979 |
| Tetraoctyliniglycol titanate | 5575-43-9 | 2A-9031981 |
| Ethyl N-(4-methylphenyl)sulfonylcarbamate | 5577-13-9 | 2A-9031982 |
| Methacryloxymethyltriethoxysilane | 5577-72-0 | 2A-9031983 |
| Decaethylene glycol | 5579-66-8 | 2A-9031984 |
| 2,3,4,5-Tetrafluoroaniline | 5580-80-3 | 2A-9031989 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA