CAS Number4849-90-5
Synonymsaristolochic acid c; 10-Hydroxy-6-nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid
Molecular FormulaC16H9NO7
Molecular Weight327.25
Purity≥70.0 (HPLC)%
Density1.7±0.1 g/cm3
Boiling Point658.7±55.0 °C at 760 mmHg
Melting Point287-292ºC
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4849-90-5 |
| Catalog No. | 2A-9031263 |
| Chinese Name | 马兜铃酸C |
| Synonyms | aristolochic acid c; 10-Hydroxy-6-nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid |
| Molecular Formula | C16H9NO7 |
| Molecular Weight | 327.25 |
| Purity | ≥70.0 (HPLC) |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 658.7±55.0 °C at 760 mmHg |
| Melting Point | 287-292ºC |
| Appearance | white powder |
| Storage Condition | 2-8℃ |
| Application | Aristolochic acid C is a derivative of Aristolochic acid. Aristolochic acid is a phospholipase A (phospholipase A2, PLA2) inhibitor that acts on Arabidopsis thaliana and can destroy the periplasmic mi |
| MDL Number | MFCD03093714 |
| SMILES | [N+](=O)([O-])c1c2c(c4c(c1)ccc(c4)O)c3c(cc2C(=O)O)OCO3 |
| InChI | 1S/C16H9NO7/c18-8-2-1-7-3-11(17(21)22)13-10(16(19)20)5-12-15(24-6-23-12)14(13)9(7)4-8/h1-5,18H,6H2,(H,19,20) |
| InChI Key | NBFGYDJKTHENDP-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/31263_1_4849_90_5.pdf |
| Transport Info | Product name: Aristolochic acid C |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Betulonic acid | 4481-62-3 | 2A-9030951 |
| Corosolic acid | 4547-24-4 | 2A-9031017 |
| Phenyl beta-D-galactopyranoside | 4630-62-0 | 2A-9031082 |
| 4-Bromostilbene | 4714-24-3 | 2A-9031135 |
| Succinyl oleanolic acid | 4847-30-7 | 2A-9031261 |
| Procyanidin | 4852-22-6 | 2A-9031265 |
| Isorhamnetin-3-O-glucoside | 5041-82-7 | 2A-9031400 |
| 4,4'-Dicyanostilbene | 5216-36-4 | 2A-9031536 |
| Cyclohexyl beta-D-glucopyranoside | 5284-99-1 | 2A-9031595 |
| Isopropyl beta-D-glucopyranoside | 5391-17-3 | 2A-9031734 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS