CAS Number4481-62-3
SynonymsBetulinonic acid; 3-Oxolup-20(29)-en-28-oic acid; Liquidambaricacid; Betulonic acid; LiquidaMba
Molecular FormulaC30H46O3
Molecular Weight454.68
Purity≥90.0 (HPLC)%
Density1.1±0.1 g/cm3
Boiling Point548.1±33.0 °C at 760 mmHg
Melting Point264 °C
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4481-62-3 |
| Catalog No. | 2A-9030951 |
| Chinese Name | 路路通酸 |
| Synonyms | Betulinonic acid; 3-Oxolup-20(29)-en-28-oic acid; Liquidambaricacid; Betulonic acid; LiquidaMba |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.68 |
| Purity | ≥90.0 (HPLC) |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 548.1±33.0 °C at 760 mmHg |
| Melting Point | 264 °C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | 0-10°C; avoid heating |
| Application | Betulonic acid belongs to the pentacyclic triterpene derivatives and has anti-tumor properties. |
| MDL Number | MFCD08459607 |
| SMILES | OC(=O)[C@]21[C@@H]([C@@H]3[C@]([C@]4([C@@H]([C@@]5([C@@H](CC4)C(C(=O)CC5)(C)C)C)CC3)C)(CC2)C)[C@@H](CC1)C(=C)C |
| InChI | 1S/C30H46O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-22,24H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,24+,27-,28+,29+,30-/m0/s1 |
| InChI Key | SLJTWDNVZKIDAU-SVAFSPIFSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/30951_1_4481_62_3.pdf |
| Transport Info | Product name: Betulinic acid |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Benzyl alpha-D-glucopyranoside | 25320-99-4 | 2A-9030747 |
| Oleanolic acid 3-acetate | 4339-72-4 | 2A-9030785 |
| Maslinic acid | 4373-41-5 | 2A-9030816 |
| 1,4-Bis[(2-hydroxyethyl)amino]anthraquinone | 4471-41-4 | 2A-9030941 |
| DL-Sulforaphane | 4478-93-7 | 2A-9030949 |
| Corosolic acid | 4547-24-4 | 2A-9031017 |
| Phenyl beta-D-galactopyranoside | 4630-62-0 | 2A-9031082 |
| 4-Bromostilbene | 4714-24-3 | 2A-9031135 |
| Succinyl oleanolic acid | 4847-30-7 | 2A-9031261 |
| Aristolochic acid C | 4849-90-5 | 2A-9031263 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS