
CAS Number4534-74-1
Synonymscis-4-ethyl-cyclohexanol; 4-Ethylcyclohexanol,cis+trans; EINECS 224-878-1; Cyclohexanol,4-ethyl; 4-ethylcyclohexanol,mixture of cis and trans; 4-ethyl-cyclohexanol; cis-4-Aethyl-cyclohexanol; cis-4-Cyclohexylphenyl-4-cyano-2,4-dimethyl-2-pentanoat; 4-Aethylcyclohexanol; 4-Ethylcyclohexanol; 4-ethylcyclohexyl alcohol; Ethylcyclohexanol; MFCD00001450; 1-Aethyl-cyclohexanol-(4)
Molecular FormulaC8H16O1
Molecular Weight128.21
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point185.7±8.0 °C at 760 mmHg
AppearanceTransparent very light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4534-74-1 |
| Catalog No. | 2A-9031005 |
| Chinese Name | 4-乙基环己醇(顺反异构体混和物) |
| Synonyms | cis-4-ethyl-cyclohexanol; 4-Ethylcyclohexanol,cis+trans; EINECS 224-878-1; Cyclohexanol,4-ethyl; 4-ethylcyclohexanol,mixture of cis and trans; 4-ethyl-cyclohexanol; cis-4-Aethyl-cyclohexanol; cis-4-Cyclohexylphenyl-4-cyano-2,4-dimethyl-2-pentanoat; 4-Aethylcyclohexanol; 4-Ethylcyclohexanol; 4-ethylcyclohexyl alcohol; Ethylcyclohexanol; MFCD00001450; 1-Aethyl-cyclohexanol-(4) |
| Molecular Formula | C8H16O1 |
| Molecular Weight | 128.21 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 185.7±8.0 °C at 760 mmHg |
| Appearance | Transparent very light yellow liquid |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2906199090 |
| MDL Number | MFCD00001450 |
| SMILES | CCC1CCC(O)CC1 |
| InChI | InChI=1S/C8H16O/c1-2-7-3-5-8(9)6-4-7/h7-9H,2-6H2,1H3 |
| InChI Key | RVTKUJWGFBADIN-UHFFFAOYSA-N |
| MSDS | msds/31005_1_4534_74_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4,5-Trimethoxybenzoyl chloride | 4521-61-3 | 2A-9030993 |
| Cyclopentanecarbonyl chloride | 4524-93-0 | 2A-9030994 |
| Dimethyl dicarbonate | 4525-33-1 | 2A-9030995 |
| Benzyltrimethylammonium iodide | 4525-46-6 | 2A-9030996 |
| 2,3-Butanedithiol | 4532-64-3 | 2A-9031002 |
| 2-Methylhexanoic acid | 4536-23-6 | 2A-9031006 |
| Piperidinium acetate | 4540-33-4 | 2A-9031007 |
| 4-Benzyloxy-1-butanol | 4541-14-4 | 2A-9031008 |
| 2,2-Dimethylcyclopentanone | 4541-32-6 | 2A-9031009 |
| N,N,N'-Trimethyl-1,3-propanediamine | 4543-96-8 | 2A-0202165 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA