
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4525-46-6 |
| Catalog No. | 2A-9030996 |
| Chinese Name | 苄基三甲基碘化铵 |
| Synonyms | MFCD00051859; N,N,N-Trimethyl-1-phenylmethanaminium iodide; benzyl(trimethyl)azanium,iodide; Benzyl trimethylammonium iodide; EINECS 224-861-9 |
| Molecular Formula | C10H16N1I1 |
| Molecular Weight | 277.15 |
| Purity | 98.00 |
| Melting Point | 178-179°C |
| Appearance | solid |
| Storage Condition | This product should be sealed and stored in a cool |
| HTC | 29239000 |
| MDL Number | MFCD00051859 |
| SMILES | C[N+](C)(C)Cc1ccccc1.[I-] |
| InChI | InChI=1S/C10H16N.HI/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChI Key | LRRJQNMXIDXNIM-UHFFFAOYSA-M |
| MSDS | msds/30996_1_4525_46_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product Name: Summary 2923900090 other quaternary ammonium salts and hydroxides. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 2-bromoprop-2-enoate | 4519-46-4 | 2A-9030988 |
| 2-Mercaptobenzyl alcohol | 4521-31-7 | 2A-9030990 |
| 3,4,5-Trimethoxybenzoyl chloride | 4521-61-3 | 2A-9030993 |
| Cyclopentanecarbonyl chloride | 4524-93-0 | 2A-9030994 |
| Dimethyl dicarbonate | 4525-33-1 | 2A-9030995 |
| 2,3-Butanedithiol | 4532-64-3 | 2A-9031002 |
| 4-Ethylcyclohexanol | 4534-74-1 | 2A-9031005 |
| 2-Methylhexanoic acid | 4536-23-6 | 2A-9031006 |
| Piperidinium acetate | 4540-33-4 | 2A-9031007 |
| 4-Benzyloxy-1-butanol | 4541-14-4 | 2A-9031008 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA