| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4524-93-0 |
| Catalog No. | 2A-9030994 |
| Chinese Name | 环戊基甲酰氯 |
| Synonyms | MFCD00001370; EINECS 224-856-1; Cyclopentanecarbonyl chloride |
| Molecular Formula | C6H9ClO |
| Molecular Weight | 226.67 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 161.5±0.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| Packaging | II |
| HTC | 29162000 |
| PubChem ID | 329819624 |
| MDL Number | MFCD09904397 |
| SMILES | O=C(Cl)C1(CCCC1)C2=CC=C(F)C=C2 |
| InChI | 1S/C12H12ClFO/c13-11(15)12(7-1-2-8-12)9-3-5-10(14)6-4-9/h3-6H,1-2,7-8H2 |
| InChI Key | KPPZDQSWBOAHHQ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Hazard Symbols | 8 |
| MSDS | msds/30994_1_4524_93_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives Sub-hazards: Category 3: Flammable liquids UN number: 2920 Proper shipping name: Corrosive Liquid, Flammable, Not Otherwise Specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl corosolate | 4518-70-1 | 2A-9030985 |
| 2,3-Difluorobenzoic acid | 4519-39-5 | 2A-9030986 |
| Methyl 2-bromoprop-2-enoate | 4519-46-4 | 2A-9030988 |
| 2-Mercaptobenzyl alcohol | 4521-31-7 | 2A-9030990 |
| 3,4,5-Trimethoxybenzoyl chloride | 4521-61-3 | 2A-9030993 |
| Dimethyl dicarbonate | 4525-33-1 | 2A-9030995 |
| Benzyltrimethylammonium iodide | 4525-46-6 | 2A-9030996 |
| 2,3-Butanedithiol | 4532-64-3 | 2A-9031002 |
| 4-Ethylcyclohexanol | 4534-74-1 | 2A-9031005 |
| 2-Methylhexanoic acid | 4536-23-6 | 2A-9031006 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS