
CAS Number3641-23-4
Synonyms2-Methoxy-5-chlormethylbenzoesaeure; 5-Chlormethyl-2-methoxy-benzoesaeure; 5-(Chloromethyl)-2-methoxybenzoic acid; FC0843
Molecular FormulaC9H9ClO3
Molecular Weight200.619
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point354.6±32.0 °C at 760 mmHg
Melting Point97-98 °C
AppearanceWhite to yellow solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3641-23-4 |
| Catalog No. | 2A-9030033 |
| Chinese Name | 5-(氯甲基)-2-甲氧基苯甲酸 |
| Synonyms | 2-Methoxy-5-chlormethylbenzoesaeure; 5-Chlormethyl-2-methoxy-benzoesaeure; 5-(Chloromethyl)-2-methoxybenzoic acid; FC0843 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.619 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 354.6±32.0 °C at 760 mmHg |
| Melting Point | 97-98 °C |
| Appearance | White to yellow solid |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2918990090 |
| SMILES | COc1ccc(CCl)cc1C(=O)O |
| InChI | InChI=1S/C9H9ClO3/c1-13-8-3-2-6(5-10)4-7(8)9(11)12/h2-4H,5H2,1H3,(H,11,12) |
| InChI Key | LXSPNZGYCRQFSD-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 6-Methoxy-2-naphthaldehyde | 3453-33-6 | 2A-9029829 |
| 1-Oxoindan-5-carboxylic acid | 3470-45-9 | 2A-9029845 |
| 4-tert-Butyl-5-chloro-2-hydroxybenzaldehyde | 3522-86-9 | 2A-9029905 |
| Diethylaminoacetaldehyde diethyl acetal | 3616-57-7 | 2A-9029994 |
| Isobutyric acid hydrazide | 3619-17-8 | 2A-9030003 |
| 5-Morpholin-4-yl-2-furaldehyde | 3680-96-4 | 2A-9030077 |
| 4-Aminophthalhydrazide | 3682-14-2 | 2A-9030081 |
| 3-Nitrophthalhydrazide | 3682-15-3 | 2A-9030082 |
| 4-Nitrophthalhydrazide | 3682-19-7 | 2A-9030083 |
| cis-4-Aminocyclohexanecarboxylic acid | 3685-23-2 | 2A-9030084 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA