
CAS Number3682-19-7
Synonyms2,3-Dihydro-6-nitro-1,4-phthalazinedione; MFCD00006891; 6-nitro-2,3-dihydrophthalazine-1,4-dione; 4-Nitrophthalhydrazide
Molecular FormulaC8H5N3O4
Molecular Weight207.14300
Purity98.00%
Density1.555g/cm3
Boiling Point626.8ºC at 760mmHg
Melting Point83-84 °C
AppearanceLight yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3682-19-7 |
| Catalog No. | 2A-9030083 |
| Chinese Name | 4-硝基邻苯二甲酰肼 |
| Synonyms | 2,3-Dihydro-6-nitro-1,4-phthalazinedione; MFCD00006891; 6-nitro-2,3-dihydrophthalazine-1,4-dione; 4-Nitrophthalhydrazide |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.14300 |
| Purity | 98.00 |
| Density | 1.555g/cm3 |
| Boiling Point | 626.8ºC at 760mmHg |
| Melting Point | 83-84 °C |
| Appearance | Light yellow powder |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2933990090 |
| SMILES | O=c1[nH][nH]c(=O)c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C8H5N3O4/c12-7-5-2-1-4(11(14)15)3-6(5)8(13)10-9-7/h1-3H,(H,9,12)(H,10,13) |
| InChI Key | XQFIOLKLHNOFCA-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.5% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Isobutyric acid hydrazide | 3619-17-8 | 2A-9030003 |
| 5-(Chloromethyl)-2-methoxybenzoic acid | 3641-23-4 | 2A-9030033 |
| 5-Morpholin-4-yl-2-furaldehyde | 3680-96-4 | 2A-9030077 |
| 4-Aminophthalhydrazide | 3682-14-2 | 2A-9030081 |
| 3-Nitrophthalhydrazide | 3682-15-3 | 2A-9030082 |
| cis-4-Aminocyclohexanecarboxylic acid | 3685-23-2 | 2A-9030084 |
| trans-4-Aminocyclohexanecarboxylic acid | 3685-25-4 | 2A-9030085 |
| 2-Chlorobenzaldehyde oxime | 3717-28-0 | 2A-9030112 |
| (Chloromethylene)dimethyliminium chloride | 3724-43-4 | 2A-9030123 |
| Calconcarboxylic acid | 3737-95-9 | 2A-9030141 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA