
CAS Number3616-57-7
SynonymsDiaethylamino-acetal; diethyl-(2,2-diethoxy-ethyl)-amine; 2,3-Diethoxytriethylamine; Ethanamine,2,2-diethoxy-N,N-diethyl; N,N-Diethyl-2,2-diethoxyethanamine; DIETHYLAMINOACETALDEHYDE DIETHYL; Diaethyl-acetalyl-amin; 2,2-Diethoxy-N,N-diethylethanamine; EINECS 222-801-6; 2,2-diethoxyethyl(diethyl)amine; 2,2-Diethoxyethyl(diethyl)amin; Diaethyl-(2,2-diaethoxy-aethyl)-amin; DIETHYLAMINOACETALDEHYDE DIETHYL ACETAL; Diaethylamino-acetaldehyd-diaethylacetal; 2,2-DIETHOXY-N,N-DIETHYL-ETHANAMINE; Diethylaminoacet
Molecular FormulaC10H23NO2
Molecular Weight189.295
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point194.5±0.0 °C at 760 mmHg
Appearanceclear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3616-57-7 |
| Catalog No. | 2A-9029994 |
| Chinese Name | 二乙氨基乙醛缩二乙醇 |
| Synonyms | Diaethylamino-acetal; diethyl-(2,2-diethoxy-ethyl)-amine; 2,3-Diethoxytriethylamine; Ethanamine,2,2-diethoxy-N,N-diethyl; N,N-Diethyl-2,2-diethoxyethanamine; DIETHYLAMINOACETALDEHYDE DIETHYL; Diaethyl-acetalyl-amin; 2,2-Diethoxy-N,N-diethylethanamine; EINECS 222-801-6; 2,2-diethoxyethyl(diethyl)amine; 2,2-Diethoxyethyl(diethyl)amin; Diaethyl-(2,2-diaethoxy-aethyl)-amin; DIETHYLAMINOACETALDEHYDE DIETHYL ACETAL; Diaethylamino-acetaldehyd-diaethylacetal; 2,2-DIETHOXY-N,N-DIETHYL-ETHANAMINE; Diethylaminoacet |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.295 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 194.5±0.0 °C at 760 mmHg |
| Appearance | clear liquid |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| HTC | 2922199090 |
| PubChem ID | 109420 |
| SMILES | CCOC(CN(CC)CC)OCC |
| InChI | InChI=1S/C10H23NO2/c1-5-11(6-2)9-10(12-7-3)13-8-4/h10H,5-9H2,1-4H3 |
| InChI Key | HNFUIXOBWCFVAJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Chloro-4-methylbenzaldehyde | 3411-03-8 | 2A-9029767 |
| 4-(Methylthio)benzaldehyde | 3446-89-7 | 2A-9029824 |
| 6-Methoxy-2-naphthaldehyde | 3453-33-6 | 2A-9029829 |
| 1-Oxoindan-5-carboxylic acid | 3470-45-9 | 2A-9029845 |
| 4-tert-Butyl-5-chloro-2-hydroxybenzaldehyde | 3522-86-9 | 2A-9029905 |
| Isobutyric acid hydrazide | 3619-17-8 | 2A-9030003 |
| 5-(Chloromethyl)-2-methoxybenzoic acid | 3641-23-4 | 2A-9030033 |
| 5-Morpholin-4-yl-2-furaldehyde | 3680-96-4 | 2A-9030077 |
| 4-Aminophthalhydrazide | 3682-14-2 | 2A-9030081 |
| 3-Nitrophthalhydrazide | 3682-15-3 | 2A-9030082 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA