CAS Number2597-56-0
Synonyms4-Nitro-2-methoxybenzoic acid; 2-methoxy-4-nitro-benzoic acid; EINECS 219-998-6; 2-Methoxy-4-nitro-benzoesaeure; Methylaether-4-nitro-salicylsaeure; 4-Nitro-o-anisic acid; 2-Methoxy-4-nitrobenzoic acid; MFCD00216573
Molecular FormulaCH3OC6H3(NO2)CO2H
Molecular Weight197.14
Purity98%
Density1.4±0.1 g/cm3
Boiling Point390.9±27.0 °C at 760 mmHg
Melting Point146-148 °C (lit.)
AppearanceWhite to light yellow crystal powder
EINECS219-998-6
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2597-56-0 |
| Catalog No. | 2A-9028794 |
| Chinese Name | 2-甲氧基-4-硝基苯甲酸 |
| Synonyms | 4-Nitro-2-methoxybenzoic acid; 2-methoxy-4-nitro-benzoic acid; EINECS 219-998-6; 2-Methoxy-4-nitro-benzoesaeure; Methylaether-4-nitro-salicylsaeure; 4-Nitro-o-anisic acid; 2-Methoxy-4-nitrobenzoic acid; MFCD00216573 |
| Molecular Formula | CH3OC6H3(NO2)CO2H |
| Molecular Weight | 197.14 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 390.9±27.0 °C at 760 mmHg |
| Melting Point | 146-148 °C (lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Sealed in a cool, dry environment. |
| EINECS | 219-998-6 |
| HTC | 2918990090 |
| PubChem ID | 24866465 |
| MDL Number | MFCD00216573 |
| SMILES | COc1cc(ccc1C(O)=O)[N+]([O-])=O |
| InChI | 1S/C8H7NO5/c1-14-7-4-5(9(12)13)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
| InChI Key | KPJXEWJRJKEOCD-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/28794_1_2597_56_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Aminoguanidine bicarbonate | 2582-30-1 | 2A-9028773 |
| Liensinine | 2586-96-1 | 2A-9028776 |
| Trioctyltin chloride | 2587-76-0 | 2A-9028779 |
| Acetoxytriethyllead(IV) | 2587-81-7 | 2A-9028780 |
| Dimethyl 2,2'-azobis(2-methylpropionate) | 2589-57-3 | 2A-9028782 |
| 2-Methylbutyl hexanoate | 2601-13-0 | 2A-9028795 |
| 2,3-Dichloropropionitrile | 2601-89-0 | 2A-9028796 |
| N,N-Diethyldecanamide | 2602-61-1 | 2A-9028797 |
| 2-Chloro-5-nitropyridin-4-amine | 2604-39-9 | 2A-9028798 |
| 2-Hydroxymethylphenanthrene | 2606-54-4 | 2A-9028802 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS