
CAS Number2604-39-9
Synonyms2-chloro-5-nitropyridin-4-amine; 2-Chloro-5-nitro-4-pyridinamine; 2-Chloro-4-aMino-5-nitropyridine; T6NJ BG DZ ENW; 4-Amino-2-chloro-5-nitro-pyridine; 2-chloro-5-nitropyridine-4-amine
Molecular FormulaC5H4ClN3O2
Molecular Weight173.557
Purity98.00%
Density1.6±0.1 g/cm3
Boiling Point388.5±37.0 °C at 760 mmHg
Melting Point190-191°C
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2604-39-9 |
| Catalog No. | 2A-9028798 |
| Chinese Name | 2-氯-4-氨基-5-硝基吡啶 |
| Synonyms | 2-chloro-5-nitropyridin-4-amine; 2-Chloro-5-nitro-4-pyridinamine; 2-Chloro-4-aMino-5-nitropyridine; T6NJ BG DZ ENW; 4-Amino-2-chloro-5-nitro-pyridine; 2-chloro-5-nitropyridine-4-amine |
| Molecular Formula | C5H4ClN3O2 |
| Molecular Weight | 173.557 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 388.5±37.0 °C at 760 mmHg |
| Melting Point | 190-191°C |
| Appearance | White to light yellow crystal powder |
| Storage Condition | 2-8°C |
| HTC | 2933399090 |
| PubChem ID | 15959230 |
| SMILES | Nc1cc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H4ClN3O2/c6-5-1-3(7)4(2-8-5)9(10)11/h1-2H,(H2,7,8) |
| InChI Key | YKWBEPUOVBMENG-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dimethyl 2,2'-azobis(2-methylpropionate) | 2589-57-3 | 2A-9028782 |
| 2-Methoxy-4-nitrobenzoic acid | 2597-56-0 | 2A-9028794 |
| 2-Methylbutyl hexanoate | 2601-13-0 | 2A-9028795 |
| 2,3-Dichloropropionitrile | 2601-89-0 | 2A-9028796 |
| N,N-Diethyldecanamide | 2602-61-1 | 2A-9028797 |
| 2-Hydroxymethylphenanthrene | 2606-54-4 | 2A-9028802 |
| Thiamphenicol glycinate hydrochloride | 2611-61-2 | 2A-9028807 |
| 5-Methoxysalicylic acid | 2612-02-4 | 2A-9028809 |
| 2-Butylpropane-1,3-diol | 2612-26-2 | 2A-9028810 |
| 2-Ethylpropane-1,3-diol | 2612-29-5 | 2A-9028811 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA