
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2586-96-1 |
| Catalog No. | 2A-9028776 |
| Chinese Name | 莲心碱 |
| Synonyms | Hiensinine |
| Molecular Formula | C37H42O6N2 |
| Molecular Weight | 610.75 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 722.0±60.0 °C at 760 mmHg |
| Melting Point | 95-99ºC |
| Appearance | Off-white powder |
| Storage Condition | room temperature |
| Application | Liensinine is an autophagy/mitophagy inhibitor. Liensinine is a major isoquinoline alkaloid extracted from the seed embryos of Nelumbo nucifera Gaertn and has a wide range of biological activities, in |
| PubChem ID | 7840779 |
| MDL Number | MFCD03427702 |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(O)c(Oc3cc4c(cc3OC)CCN(C)C4Cc3ccc(O)cc3)c1)N(C)CC2 |
| InChI | InChI=1S/C37H42N2O6/c1-38-14-13-26-20-35(43-4)37(22-29(26)30(38)16-23-6-9-27(40)10-7-23)45-33-18-24(8-11-32(33)41)17-31-28-21-36(44-5)34(42-3)19-25(28)12-15-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1 |
| InChI Key | XCUCMLUTCAKSOZ-FIRIVFDPSA-N |
| MSDS | msds/28776_1_2586_96_1.pdf |
| Transport Info | Product Name: Liensinine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromoethylamine hydrobromide | 2576-47-8 | 2A-9028765 |
| Sulfapiridazin sodium | 2577-32-4 | 2A-9028766 |
| Methyl L-isoleucinate | 2577-46-0 | 2A-9028767 |
| 3-Methyl-4-nitrophenol | 2581-34-2 | 2A-9028772 |
| Aminoguanidine bicarbonate | 2582-30-1 | 2A-9028773 |
| Trioctyltin chloride | 2587-76-0 | 2A-9028779 |
| Acetoxytriethyllead(IV) | 2587-81-7 | 2A-9028780 |
| Dimethyl 2,2'-azobis(2-methylpropionate) | 2589-57-3 | 2A-9028782 |
| 2-Methoxy-4-nitrobenzoic acid | 2597-56-0 | 2A-9028794 |
| 2-Methylbutyl hexanoate | 2601-13-0 | 2A-9028795 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA