CAS Number2100-42-7
SynonymsEINECS 218-267-9; Benzene,2-chloro-1,4-dimethoxy; Chloro-1,4-dimethoxybenzene; Chlorohydroquinone dimethyl ether; 2,5-dimethoxyphenyl chloride; 2,5-dimethoxychlorobenzene; 1-chloro-2,5-dimethoxybenzene; 2-Chloro-1,4-dimethoxybenzene; 2,5-dimethoxy-4-chloro-benzene; 2-chloro-1,4-dimethoxy-benzene; 3-chloro-1,4-dimethoxybenzene; MFCD00008356
Molecular FormulaC8H9ClO2
Molecular Weight172.61
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point238.2±20.0 °C at 760 mmHg
Melting Point8.1 °C
AppearanceTransparent light pink to green or blue liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2100-42-7 |
| Catalog No. | 2A-9027976 |
| Chinese Name | 2,5-二甲氧基氯苯 |
| Synonyms | EINECS 218-267-9; Benzene,2-chloro-1,4-dimethoxy; Chloro-1,4-dimethoxybenzene; Chlorohydroquinone dimethyl ether; 2,5-dimethoxyphenyl chloride; 2,5-dimethoxychlorobenzene; 1-chloro-2,5-dimethoxybenzene; 2-Chloro-1,4-dimethoxybenzene; 2,5-dimethoxy-4-chloro-benzene; 2-chloro-1,4-dimethoxy-benzene; 3-chloro-1,4-dimethoxybenzene; MFCD00008356 |
| Molecular Formula | C8H9ClO2 |
| Molecular Weight | 172.61 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 238.2±20.0 °C at 760 mmHg |
| Melting Point | 8.1 °C |
| Appearance | Transparent light pink to green or blue liquid |
| Water Solubility | practically insoluble |
| Storage Condition | Store away from contact with oxidants, seal the co |
| HTC | 2909309090 |
| PubChem ID | 108196 |
| MDL Number | C8H9ClO2 |
| SMILES | COc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C8H9ClO2/c1-10-6-3-4-8(11-2)7(9)5-6/h3-5H,1-2H3 |
| InChI Key | QMXZSRVFIWACJH-UHFFFAOYSA-N |
| MSDS | msds/27976_1_2100_42_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Phenolphthalein diphosphate | 2090-82-6 | 2A-9027964 |
| 1-Adamantanecarbonyl chloride | 2094-72-6 | 2A-9027966 |
| 4,4'-Bis(dimethylhydroxysilyl)diphenyl ether | 2096-54-0 | 2A-9027971 |
| 2,3,5,6-Tetramethyliodobenzene | 2100-25-6 | 2A-9027974 |
| 2-Propoxybenzoic acid | 2100-31-4 | 2A-9027975 |
| 4-(4-Chlorophenyl)-4-thiazoline-2-thione | 2104-00-9 | 2A-9027981 |
| 4-(4-Methoxyphenyl)-1,3-thiazol-2-amine | 2104-04-3 | 2A-9027982 |
| 5,6-Dimethoxy-1-indanone | 2107-69-9 | 2A-9027996 |
| 3-Bromobiphenyl | 2113-57-7 | 2A-9028002 |
| 4-Biphenylsulfonic acid | 2113-68-0 | 2A-9028003 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS