CAS Number2113-57-7
Synonyms3-bromo-1,1'-biphenyl; MFCD00000082; m-Bromobipheny; 3-phenylbromobenzene; Biphenyl,3-bromo; EINECS 218-304-9; 3-Bromobiphenyl; m-Bromobiphenyl; 3-Bromodiphenyl; 3-biphenylbromide; 1,1'-Biphenyl,3-bromo
Molecular FormulaC12H9Br
Molecular Weight277.12
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point300.0±9.0 °C at 760 mmHg
Melting Point9ºC
AppearanceLight yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2113-57-7 |
| Catalog No. | 2A-9028002 |
| Chinese Name | 间溴联苯 |
| Synonyms | 3-bromo-1,1'-biphenyl; MFCD00000082; m-Bromobipheny; 3-phenylbromobenzene; Biphenyl,3-bromo; EINECS 218-304-9; 3-Bromobiphenyl; m-Bromobiphenyl; 3-Bromodiphenyl; 3-biphenylbromide; 1,1'-Biphenyl,3-bromo |
| Molecular Formula | C12H9Br |
| Molecular Weight | 277.12 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 300.0±9.0 °C at 760 mmHg |
| Melting Point | 9ºC |
| Appearance | Light yellow liquid |
| Water Solubility | Insoluble |
| Storage Condition | The storage place must be away from oxidants, keep |
| Packaging | II |
| HTC | 2903999090 |
| PubChem ID | 477455 |
| SMILES | Brc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H9Br/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| InChI Key | USYQKCQEVBFJRP-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Propoxybenzoic acid | 2100-31-4 | 2A-9027975 |
| 2-Chloro-1,4-dimethoxybenzene | 2100-42-7 | 2A-9027976 |
| 4-(4-Chlorophenyl)-4-thiazoline-2-thione | 2104-00-9 | 2A-9027981 |
| 4-(4-Methoxyphenyl)-1,3-thiazol-2-amine | 2104-04-3 | 2A-9027982 |
| 5,6-Dimethoxy-1-indanone | 2107-69-9 | 2A-9027996 |
| 4-Biphenylsulfonic acid | 2113-68-0 | 2A-9028003 |
| 2-Chloroethyl carbamate | 2114-18-3 | 2A-9028006 |
| Phenyltris(trimethylsiloxy)silane | 2116-84-9 | 2A-9028008 |
| Bis(trimethylstannyl)acetylene | 2117-50-2 | 2A-9028010 |
| 4-Amino-3,5-diiodobenzoic acid | 2122-61-4 | 2A-9028011 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS