
CAS Number2094-72-6
SynonymsEINECS 218-252-7; Adamantane-1-carbonyl chloride; 1-Adamantanecarboxlic acid chloride; adamantanecarboxylic acid chloride; 1-Adamantanoic acid chloride; adamantanecarbonyl chloride; Tricyclo[3.3.1.1]decane-1-carbonyl chloride; MFCD00074724; 1-AdamantanecarbonylChloride; Adamantane-1-carboxylic acid chloride; 1-Adamantanecarbonyl chloride; 1-Adamantyl carbonyl chloride; 1-Adamantanecarboxylic acid chloride; 1-Adamantoyl chloride; 1-ADAMANTYLCARBONYL CHLORIDE; Adamantoyl chloride
Molecular FormulaC11H15ClO
Molecular Weight198.69
Purity95%
Density1.2±0.1 g/cm3
Boiling Point135-136 °C/10 mmHg (lit.)
Melting Point49-51 °C (lit.)
Appearancesolid
EINECS218-252-7
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2094-72-6 |
| Catalog No. | 2A-9027966 |
| Chinese Name | 1-金刚烷甲酰氯 |
| Synonyms | EINECS 218-252-7; Adamantane-1-carbonyl chloride; 1-Adamantanecarboxlic acid chloride; adamantanecarboxylic acid chloride; 1-Adamantanoic acid chloride; adamantanecarbonyl chloride; Tricyclo[3.3.1.1]decane-1-carbonyl chloride; MFCD00074724; 1-AdamantanecarbonylChloride; Adamantane-1-carboxylic acid chloride; 1-Adamantanecarbonyl chloride; 1-Adamantyl carbonyl chloride; 1-Adamantanecarboxylic acid chloride; 1-Adamantoyl chloride; 1-ADAMANTYLCARBONYL CHLORIDE; Adamantoyl chloride |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 |
| Purity | 95 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 135-136 °C/10 mmHg (lit.) |
| Melting Point | 49-51 °C (lit.) |
| Appearance | solid |
| Water Solubility | may decompose |
| Storage Condition | Store away from contact with oxidants, away from w |
| Packaging | III |
| EINECS | 218-252-7 |
| HTC | 2915900090 |
| PubChem ID | 24847343 |
| MDL Number | MFCD00074724 |
| SMILES | ClC(=O)C12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| InChI | 1S/C11H15ClO/c12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2/t7-,8+,9-,11- |
| InChI Key | MIBQYWIOHFTKHD-KJZNFTALSA-N |
| Beilstein/REAXYS | 389960 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/27966_1_2094_72_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Decyltrimethylammonium bromide | 2082-84-0 | 2A-9027955 |
| 3-Methyl-2-butanethiol | 2084-18-6 | 2A-9027957 |
| 2-Pentanethiol | 2084-19-7 | 2A-9027958 |
| Calcium benzoate | 2090-05-3 | 2A-9027963 |
| Phenolphthalein diphosphate | 2090-82-6 | 2A-9027964 |
| 4,4'-Bis(dimethylhydroxysilyl)diphenyl ether | 2096-54-0 | 2A-9027971 |
| 2,3,5,6-Tetramethyliodobenzene | 2100-25-6 | 2A-9027974 |
| 2-Propoxybenzoic acid | 2100-31-4 | 2A-9027975 |
| 2-Chloro-1,4-dimethoxybenzene | 2100-42-7 | 2A-9027976 |
| 4-(4-Chlorophenyl)-4-thiazoline-2-thione | 2104-00-9 | 2A-9027981 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA