
CAS Number2084-18-6
SynonymsDimethyl-1,2-propanthiol; 3-Methyl-2-butyl Mercaptan; 1,2-dimethyl-n-propylmercaptan; 3-Methyl-2-butanethiol; 3-Methyl-butan-2-thiol; 2-Butanethiol,3-methyl; MFCD00039648; 3-Methyl-2-butane thiol; 3-Methylbutane-2-thiol; 3-Methylbutylmercaptan-(2); 3-methyl-butane-2-thiol; EINECS 218-223-9; UNII:JE3PR84J0B; FEMA No. 3304
Molecular FormulaC5H12S
Molecular Weight229.62
Purity98.00%
Density0.841
Boiling Point109-112 ºC
AppearanceLiquid;Colorless to Almost colorless clear liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2084-18-6 |
| Catalog No. | 2A-9027957 |
| Chinese Name | 3-甲基-2-丁硫醇 |
| Synonyms | Dimethyl-1,2-propanthiol; 3-Methyl-2-butyl Mercaptan; 1,2-dimethyl-n-propylmercaptan; 3-Methyl-2-butanethiol; 3-Methyl-butan-2-thiol; 2-Butanethiol,3-methyl; MFCD00039648; 3-Methyl-2-butane thiol; 3-Methylbutane-2-thiol; 3-Methylbutylmercaptan-(2); 3-methyl-butane-2-thiol; EINECS 218-223-9; UNII:JE3PR84J0B; FEMA No. 3304 |
| Molecular Formula | C5H12S |
| Molecular Weight | 229.62 |
| Purity | 98.00 |
| Density | 0.841 |
| Boiling Point | 109-112 ºC |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Store away from contact with oxidants, seal the co |
| Packaging | II |
| HTC | 2930909090 |
| PubChem ID | 6778871 |
| SMILES | O=C(OC)C1=CC=CC(=C1CCl)N(=O)=O |
| InChI | InChI=1S/C9H8ClNO4/c1-15-9(12)6-3-2-4-8(11(13)14)7(6)5-10/h2-4H,5H2,1H3 |
| InChI Key | OGMCDJBYZAKJTP-UHFFFAOYSA-N |
| UNSPSC | 41116107 |
| Hazard Symbols | 3 |
| MSDS | msds/27957_1_2084_18_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 3336 Proper shipping name: Mercaptan, Liquid, Flammable, Not Otherwise Specified Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tetrahydro-4-pyranol | 2081-44-9 | 2A-9027951 |
| Valeric anhydride | 2082-59-9 | 2A-9027952 |
| Octadecyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate | 2082-79-3 | 2A-9027953 |
| 1,4-Butanediol dimethacrylate | 2082-81-7 | 2A-9027954 |
| Decyltrimethylammonium bromide | 2082-84-0 | 2A-9027955 |
| 2-Pentanethiol | 2084-19-7 | 2A-9027958 |
| Calcium benzoate | 2090-05-3 | 2A-9027963 |
| Phenolphthalein diphosphate | 2090-82-6 | 2A-9027964 |
| 1-Adamantanecarbonyl chloride | 2094-72-6 | 2A-9027966 |
| 4,4'-Bis(dimethylhydroxysilyl)diphenyl ether | 2096-54-0 | 2A-9027971 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA