
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2096-86-8 |
| Catalog No. | 2A-9027972 |
| Chinese Name | 4-甲基苯丙酮 |
| Synonyms | p-Methylphenyl acetone; methyl 4-methylbenzyl ketone; p-tolunylacetone; MFCD00017250; 4-Methylphenylacetone; 1-p-tolylpropan-2-one |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.2 |
| Purity | 98.00 |
| Density | 0.974g/cm3 |
| Boiling Point | 132 °C |
| Storage Condition | Store away from contact with oxidants, seal the co |
| HTC | 2914399090 |
| PubChem ID | 439907 |
| SMILES | CC(=O)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C10H12O/c1-8-3-5-10(6-4-8)7-9(2)11/h3-6H,7H2,1-2H3 |
| InChI Key | NOXKUHSBIXPZBJ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2-[(4-Nitrophenyl)amino]ethanol | 1965-54-4 | 2A-9027742 |
| 2,2,2-Trichloro-1-phenylethanol | 2000-43-3 | 2A-9027783 |
| 1,3,5-Cyclohexanetriol | 2041-15-8 | 2A-9027870 |
| 2,3,6-Trichlorotoluene | 2077-46-5 | 2A-9027948 |
| 1,1'-Azobis(cyanocyclohexane) | 2094-98-6 | 2A-9027969 |
| 1-Phenyl-1-cyclohexanecarbonitrile | 2201-23-2 | 2A-9028135 |
| N-Methyl-N-(N,N-dimethylaminoethyl)-aminoethanol | 2212-32-0 | 2A-9028150 |
| 1,4-Cyclohexanebis(methylamine) | 2549-93-1 | 2A-9028726 |
| Benzylacetone | 2550-26-7 | 2A-9028729 |
| 1,3-Cyclohexanebis(methylamine) | 2579-20-6 | 2A-9028768 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA